| id | C00002518 | 
|---|---|
| Name | Daidzin / Daidzoside / Daidzein 7-O-glucoside | 
| CAS RN | 552-66-9 | 
| Standard InChI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16?,18-,19+,20?,21-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 2 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL486422 | 
| By LinkDB | C10216 | 
|---|
| By CAS RN | C013908 | 
|---|
| class name | count | 
|---|---|
| rosids | 26 | 
| eudicotyledons | 1 | 
| family name | count | 
|---|---|
| Fabaceae | 25 | 
| Streptomycetaceae | 1 | 
| Begoniaceae | 1 | 
| Amaranthaceae | 1 | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04637 | Cellular tumor antigen p53 | Transcription Factor | CHEMBL486422 | CHEMBL1738132
                        (1) | 7 / 44 | 
| Q16637 | Survival motor neuron protein | Unclassified protein | CHEMBL486422 | CHEMBL1613842
                        (1) | 4 / 2 | 
| P05091 | Aldehyde dehydrogenase, mitochondrial | Oxidoreductase | CHEMBL486422 | CHEMBL641008
                        (1)
                        CHEMBL641141
                        (1) CHEMBL693590 (1) CHEMBL693591 (1) CHEMBL693592 (1) CHEMBL693593 (1) | 1 / 1 | 
| P51151 | Ras-related protein Rab-9A | Unclassified protein | CHEMBL486422 | CHEMBL1613838
                        (1) | 0 / 0 | 
| P38398 | Breast cancer type 1 susceptibility protein | Enzyme | CHEMBL486422 | CHEMBL2114807
                        (1) | 4 / 2 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL486422 | CHEMBL1794401
                        (1) | 0 / 0 | 
| O15118 | Niemann-Pick C1 protein | Unclassified protein | CHEMBL486422 | CHEMBL1614342
                        (1) | 1 / 1 | 
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL486422 | CHEMBL1738588
                        (1)
                        CHEMBL1738317
                        (1) | 0 / 0 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL486422 | CHEMBL1794536
                        (1) | 0 / 0 | 
| P27338 | Amine oxidase [flavin-containing] B | Oxidoreductase | CHEMBL486422 | CHEMBL879881
                        (1)
                        CHEMBL689869
                        (1) CHEMBL689870 (1) CHEMBL689871 (1) CHEMBL731144 (1) CHEMBL731146 (1) | 0 / 0 | 
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL486422 | CHEMBL879881
                        (1)
                        CHEMBL689869
                        (1) CHEMBL689870 (1) CHEMBL689871 (1) CHEMBL731144 (1) CHEMBL731146 (1) | 1 / 1 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C013908 | 217 | ALDH2 ALDH-E2 ALDHI ALDM | aldehyde dehydrogenase 2 family (mitochondrial) (EC:1.2.1.3) | daidzin inhibits the reaction [ALDH2 protein results in increased hydrolysis of 4-nitrophenyl acetate] | decreases reaction / increases hydrolysis | protein | 21349255 | 
| C013908 | 217 | ALDH2 ALDH-E2 ALDHI ALDM | aldehyde dehydrogenase 2 family (mitochondrial) (EC:1.2.1.3) | daidzin inhibits the reaction [ALDH2 protein results in increased oxidation of propionaldehyde] | decreases reaction / increases oxidation | protein | 21349255 | 
| C013908 | 2353 | FOS AP-1 C-FOS p55 | FBJ murine osteosarcoma viral oncogene homolog | daidzin results in increased expression of FOS mRNA | increases expression | mRNA | 17142977 | 
| C013908 | 5241 | PGR NR3C3 PR | progesterone receptor | daidzin results in increased expression of PGR protein | increases expression | protein | 17142977 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #202300 | Adrenocortical carcinoma, hereditary; adcc | P04637 | 
| #610251 | Alcohol sensitivity, acute | P05091 | 
| #614740 | Basal cell carcinoma, susceptibility to, 7; bcc7 | P04637 | 
| #114480 | Breast cancer | P38398 | 
| #604370 | Breast-ovarian cancer, familial, susceptibility to, 1; brovca1 | P38398 | 
| #300615 | Brunner syndrome | P21397 | 
| #133239 | Esophageal cancer | P04637 | 
| #151623 | Li-fraumeni syndrome 1; lfs1 | P04637 | 
| #211980 | Lung cancer | P04637 | 
| #257220 | Niemann-pick disease, type c1; npc1 | O15118 | 
| #167000 | Ovarian cancer | P38398 | 
| #614320 | Pancreatic cancer, susceptibility to, 4; pnca4 | P38398 | 
| #260500 | Papilloma of choroid plexus; cpp | P04637 | 
| #253300 | Spinal muscular atrophy, type i; sma1 | Q16637 | 
| #253550 | Spinal muscular atrophy, type ii; sma2 | Q16637 | 
| #253400 | Spinal muscular atrophy, type iii; sma3 | Q16637 | 
| #271150 | Spinal muscular atrophy, type iv; sma4 | Q16637 | 
| #275355 | Squamous cell carcinoma, head and neck; hnscc | P04637 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00136 | Niemann-Pick disease type C (NPC) | O15118
                            (related) | 
| H00004 | Chronic myeloid leukemia (CML) | P04637
                            (related) | 
| H00005 | Chronic lymphocytic leukemia (CLL) | P04637
                            (related) | 
| H00006 | Hairy-cell leukemia | P04637
                            (related) | 
| H00008 | Burkitt lymphoma | P04637
                            (related) | 
| H00009 | Adult T-cell leukemia | P04637
                            (related) | 
| H00010 | Multiple myeloma | P04637
                            (related) | 
| H00013 | Small cell lung cancer | P04637
                            (related) | 
| H00014 | Non-small cell lung cancer | P04637
                            (related) | 
| H00015 | Malignant pleural mesothelioma | P04637
                            (related) | 
| H00016 | Oral cancer | P04637
                            (related) P04637 (marker) | 
| H00017 | Esophageal cancer | P04637
                            (related) P04637 (marker) | 
| H00018 | Gastric cancer | P04637
                            (related) | 
| H00019 | Pancreatic cancer | P04637
                            (related) P04637 (marker) | 
| H00020 | Colorectal cancer | P04637
                            (related) P04637 (marker) | 
| H00022 | Bladder cancer | P04637
                            (related) | 
| H00025 | Penile cancer | P04637
                            (related) P04637 (marker) | 
| H00026 | Endometrial Cancer | P04637
                            (related) | 
| H00027 | Ovarian cancer | P04637
                            (related) P38398 (related) | 
| H00028 | Choriocarcinoma | P04637
                            (related) | 
| H00029 | Vulvar cancer | P04637
                            (related) | 
| H00031 | Breast cancer | P04637
                            (related) P38398 (related) | 
| H00032 | Thyroid cancer | P04637
                            (related) | 
| H00033 | Adrenal carcinoma | P04637
                            (related) | 
| H00036 | Osteosarcoma | P04637
                            (related) | 
| H00038 | Malignant melanoma | P04637
                            (related) | 
| H00039 | Basal cell carcinoma | P04637
                            (related) | 
| H00040 | Squamous cell carcinoma | P04637
                            (related) | 
| H00041 | Kaposi's sarcoma | P04637
                            (related) | 
| H00042 | Glioma | P04637
                            (related) P04637 (marker) | 
| H00044 | Cancer of the anal canal | P04637
                            (related) | 
| H00046 | Cholangiocarcinoma | P04637
                            (related) | 
| H00047 | Gallbladder cancer | P04637
                            (related) | 
| H00048 | Hepatocellular carcinoma | P04637
                            (related) | 
| H00055 | Laryngeal cancer | P04637
                            (related) P04637 (marker) | 
| H00881 | Li-Fraumeni syndrome | P04637
                            (related) | 
| H01007 | Choroid plexus papilloma | P04637
                            (related) | 
| H00021 | Renal cell carcinoma | P04637
                            (marker) | 
| H01071 | Acute alcohol sensitivity | P05091
                            (related) | 
| H00548 | Brunner syndrome | P21397
                            (related) | 
| H00455 | Spinal muscular atrophy (SMA) | Q16637
                            (related) Q16637 (related) |