| id | C00025269 |
|---|---|
| Name | Nornantenine / N-Nornantenine / (+)-Nornantenine |
| CAS RN | 15401-66-8 |
| Standard InChI | InChI=1S/C19H19NO4/c1-21-16-6-10-3-4-20-13-5-11-7-14-15(24-9-23-14)8-12(11)18(17(10)13)19(16)22-2/h6-8,13,20H,3-5,9H2,1-2H3/t13-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C19H19NO4/c1-21-16-6-10-3-4-20-13-5-11-7-14-15(24-9-23-14)8-12(11)18(17(10)13)19(16)22-2/h6-8,13,20H,3-5,9H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 20 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1254951 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Annonaceae | 1 |
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cyclea atjehensis Forman | 152372 | Menispermaceae | eudicotyledons | Viridiplantae |
| Xylopia parviflora | 992813 | Annonaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL1254951 |
CHEMBL1251998
(1)
|
0 / 0 |