| id | C00002554 |
|---|---|
| Name | Orobol / Santol / Norsantal / 5,7,3',4'-Tetrahydroxyisoflavone |
| CAS RN | 480-23-9 |
| Standard InChI | InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| Standard InChI (Main Layer) | InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | CHEMBL241609 |
|---|---|
| By standard InChI Main Layer | CHEMBL241609 |
| By LinkDB | C10510 |
|---|
| By CAS RN | C059811 |
|---|
| class name | count |
|---|---|
| rosids | 14 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 10 |
| Moraceae | 4 |
| Annonaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00533 | Epidermal growth factor receptor | TK tyrosine-protein kinase EGFR subfamily | CHEMBL241609 |
CHEMBL941404
(2)
|
1 / 11 |
| KEGG | disease name | UniProt |
|---|---|---|
| H00016 | Oral cancer |
P00533
(related)
P00533 (marker) |
| H00017 | Esophageal cancer |
P00533
(related)
|
| H00018 | Gastric cancer |
P00533
(related)
|
| H00022 | Bladder cancer |
P00533
(related)
|
| H00028 | Choriocarcinoma |
P00533
(related)
|
| H00030 | Cervical cancer |
P00533
(related)
|
| H00042 | Glioma |
P00533
(related)
P00533 (marker) |
| H00055 | Laryngeal cancer |
P00533
(related)
P00533 (marker) |