| id | C00025644 |
|---|---|
| Name | (+)-5'-Hydroxytelobine |
| CAS RN | 109361-78-6 |
| Standard InChI | InChI=1S/C35H34N2O6/c1-37-13-11-23-31-26(37)15-19-4-7-22(8-5-19)41-28-16-20(6-9-27(28)39-2)14-25-24-18-30-29(17-21(24)10-12-36-25)43-35(33(31)42-30)34(40-3)32(23)38/h4-9,16-18,25-26,36,38H,10-15H2,1-3H3/t25-,26+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C35H34N2O6/c1-37-13-11-23-31-26(37)15-19-4-7-22(8-5-19)41-28-16-20(6-9-27(28)39-2)14-25-24-18-30-29(17-21(24)10-12-36-25)43-35(33(31)42-30)34(40-3)32(23)38/h4-9,16-18,25-26,36,38H,10-15H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 10 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cocculus pendulus (Forsk.) Diels | 13440 | Menispermaceae | eudicotyledons | Viridiplantae |