| id | C00025688 |
|---|---|
| Name | Tannagine / (+)-Tannagine / 14-Epi-(+)-stephodeline |
| CAS RN | 123750-34-5 |
| Standard InChI | InChI=1S/C21H27NO5/c1-22-7-6-21-11-15(23)19(26-4)20(27-5)18(21)14(22)8-12-9-16(24-2)17(25-3)10-13(12)21/h9-10,14,18H,6-8,11H2,1-5H3/t14-,18+,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H27NO5/c1-22-7-6-21-11-15(23)19(26-4)20(27-5)18(21)14(22)8-12-9-16(24-2)17(25-3)10-13(12)21/h9-10,14,18H,6-8,11H2,1-5H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 346 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Menispermaceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stephania cepharantha Hayata | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |
| Stephania yunnanensis | 152371 | Menispermaceae | eudicotyledons | Viridiplantae |
| Stephania zippeliana Miq. | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |