| id | C00025999 |
|---|---|
| Name | Pachygonamine |
| CAS RN | 87686-93-9 |
| Standard InChI | InChI=1S/C34H32N2O6/c1-39-27-6-4-18-12-23(27)22-11-17(3-5-26(22)37)13-24-21-16-29-28(15-19(21)7-9-35-24)42-34-31(38)32(40-2)20-8-10-36-25(14-18)30(20)33(34)41-29/h3-6,11-12,15-16,24-25,35-38H,7-10,13-14H2,1-2H3/t24?,25-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C34H32N2O6/c1-39-27-6-4-18-12-23(27)22-11-17(3-5-26(22)37)13-24-21-16-29-28(15-19(21)7-9-35-24)42-34-31(38)32(40-2)20-8-10-36-25(14-18)30(20)33(34)41-29/h3-6,11-12,15-16,24-25,35-38H,7-10,13-14H2,1-2H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 10 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pachygone ovata Miers | 152360 | Menispermaceae | eudicotyledons | Viridiplantae |