| id | C00002605 |
|---|---|
| Name | (+)-Galbacin |
| CAS RN | 61891-31-4 |
| Standard InChI | InChI=1S/C20H20O5/c1-11-12(2)20(14-4-6-16-18(8-14)24-10-22-16)25-19(11)13-3-5-15-17(7-13)23-9-21-15/h3-8,11-12,19-20H,9-10H2,1-2H3/t11-,12-,19-,20-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O5/c1-11-12(2)20(14-4-6-16-18(8-14)24-10-22-16)25-19(11)13-3-5-15-17(7-13)23-9-21-15/h3-8,11-12,19-20H,9-10H2,1-2H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 621 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1980140 CHEMBL2151191 |
| By LinkDB | C10616 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 3 |
| family name | count |
|---|---|
| Aristolochiaceae | 1 |
| Lauraceae | 1 |
| Myristicaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aristolochia triangularis | 158574 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| Machilus japonica | 325535 | Lauraceae | Magnoliophyta | Viridiplantae |
| Virola surinamensis | 224910 | Myristicaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q16539 | Mitogen-activated protein kinase 14 | p38 | CHEMBL1980140 CHEMBL2151191 |
CHEMBL2155146
(2)
CHEMBL2155147
(1)
|
0 / 0 |
| P45984 | Mitogen-activated protein kinase 9 | Jnk | CHEMBL1980140 CHEMBL2151191 |
CHEMBL2155141
(2)
CHEMBL2155142
(2)
CHEMBL2155143 (2) CHEMBL2155144 (1) |
0 / 0 |