| id | C00026088 |
|---|---|
| Name | (-)-Corypalmine |
| CAS RN | 6018-40-2 |
| Standard InChI | InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3/t16-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 37 |
| By standard InChI | CHEMBL2334885 |
|---|---|
| By standard InChI Main Layer | CHEMBL2334885 CHEMBL2334886 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Menispermaceae | 1 |
| Papaveraceae | 1 |
| Ranunculaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Corydalis ophiocarpa Thoms | 3463 | Papaveraceae | eudicotyledons | Viridiplantae |
| Hydrastis canadensis L. | 13569 | Ranunculaceae | eudicotyledons | Viridiplantae |
| Stephania micrantha H.S.Lo.et.M.Yang | 147243 | Menispermaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL2334885 CHEMBL2334886 |
CHEMBL2343280
(2)
CHEMBL2343284
(2)
|
0 / 0 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL2334885 CHEMBL2334886 |
CHEMBL2343279
(2)
CHEMBL2343283
(2)
|
2 / 0 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL2334885 CHEMBL2334886 |
CHEMBL2343277
(2)
CHEMBL2343281
(2)
|
0 / 0 |
| P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL2334885 CHEMBL2334886 |
CHEMBL2343278
(2)
CHEMBL2343282
(2)
|
1 / 0 |