id | C00026245 |
---|---|
Name | Glycosminine / Glycophymine / N-Demethylarborine |
CAS RN | 4765-56-4 |
Standard InChI | InChI=1S/C15H12N2O/c18-15-12-8-4-5-9-13(12)16-14(17-15)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17,18) |
Standard InChI (Main Layer) | InChI=1S/C15H12N2O/c18-15-12-8-4-5-9-13(12)16-14(17-15)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17,18) |
Phytochemical cluster | No. 7 |
---|---|
KCF-S cluster | No. 2751 |
By standard InChI | CHEMBL1604716 |
---|---|
By standard InChI Main Layer | CHEMBL1604716 |
By LinkDB | C10688 |
---|
By CAS RN | C015247 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Glycosmis arborea | 68543 | Rutaceae | rosids | Viridiplantae |
Glycosmis pentaphylla | 76967 | Rutaceae | rosids | Viridiplantae |
Ruta sp. | 37564 | Rutaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1604716 |
CHEMBL1614410
(1)
|
1 / 3 |
Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1604716 |
CHEMBL1794483
(1)
|
0 / 0 |
Q8IUX4 | DNA dC->dU-editing enzyme APOBEC-3F | Enzyme | CHEMBL1604716 |
CHEMBL1963966
(1)
|
0 / 0 |
O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL1604716 |
CHEMBL2114738
(1)
|
0 / 0 |