| id | C00027245 |
|---|---|
| Name | 10-O-Demethylcephaeline / (-)-10-Demethylcephaeline |
| CAS RN | 29700-91-2 |
| Standard InChI | InChI=1S/C27H36N2O4/c1-4-16-15-29-8-6-18-12-26(32-2)25(31)13-21(18)23(29)10-19(16)9-22-20-14-27(33-3)24(30)11-17(20)5-7-28-22/h11-14,16,19,22-23,28,30-31H,4-10,15H2,1-3H3/t16-,19-,22+,23-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H36N2O4/c1-4-16-15-29-8-6-18-12-26(32-2)25(31)13-21(18)23(29)10-19(16)9-22-20-14-27(33-3)24(30)11-17(20)5-7-28-22/h11-14,16,19,22-23,28,30-31H,4-10,15H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 510 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alangium lamarckii | 16896 | Cornaceae | asterids | Viridiplantae |
| Alangium longiflorum | 616982 | Cornaceae | asterids | Viridiplantae |
| Cephaelis acuminata | 77880 | Rubiaceae | asterids | Viridiplantae |