id | C00002737 |
---|---|
Name | Dillapiole |
CAS RN | 484-31-1 |
Standard InChI | InChI=1S/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3 |
Standard InChI (Main Layer) | InChI=1S/C12H14O4/c1-4-5-8-6-9-11(16-7-15-9)12(14-3)10(8)13-2/h4,6H,1,5,7H2,2-3H3 |
Phytochemical cluster | No. 6 |
---|---|
KCF-S cluster | No. 1917 |
By standard InChI | CHEMBL470874 |
---|---|
By standard InChI Main Layer | CHEMBL470874 |
By LinkDB | C10449 |
---|
By CAS RN | C059115 |
---|
class name | count |
---|---|
asterids | 4 |
Magnoliophyta | 3 |
family name | count |
---|---|
Apiaceae | 3 |
Piperaceae | 2 |
Asteraceae | 1 |
Atherospermataceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P06746 | DNA polymerase beta | Enzyme | CHEMBL470874 |
CHEMBL999199
(1)
|
0 / 0 |