| id | C00027515 |
|---|---|
| Name | Aristolactam / Aristolactam I |
| CAS RN | 13395-02-3 |
| Standard InChI | InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19) |
| Standard InChI (Main Layer) | InChI=1S/C17H11NO4/c1-20-12-4-2-3-8-9(12)5-11-14-10(17(19)18-11)6-13-16(15(8)14)22-7-21-13/h2-6H,7H2,1H3,(H,18,19) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 125 |
| By standard InChI | CHEMBL479127 |
|---|---|
| By standard InChI Main Layer | CHEMBL479127 |
| By LinkDB |
|---|
| By CAS RN | C121135 |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 6 |
| family name | count |
|---|---|
| Aristolochiaceae | 5 |
| Annonaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL479127 |
CHEMBL1067148
(1)
CHEMBL1067154
(1)
|
0 / 0 |