| id | C00027520 |
|---|---|
| Name | Aristolochic acid VIIa / 7-Hydroxyaristolochate A / 7-Hydroxyaristolochic acid / 7-Hydroxyaristolochic acid I / 7-Hydroxy-aristolochic acid A |
| CAS RN | 79185-75-4 |
| Standard InChI | InChI=1S/C17H11NO8/c1-24-15-8-4-10(18(22)23)13-9(17(20)21)5-12-16(26-6-25-12)14(13)7(8)2-3-11(15)19/h2-5,19H,6H2,1H3,(H,20,21) |
| Standard InChI (Main Layer) | InChI=1S/C17H11NO8/c1-24-15-8-4-10(18(22)23)13-9(17(20)21)5-12-16(26-6-25-12)14(13)7(8)2-3-11(15)19/h2-5,19H,6H2,1H3,(H,20,21) |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 291 |
| By standard InChI | CHEMBL600828 |
|---|---|
| By standard InChI Main Layer | CHEMBL600828 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 4 |
| family name | count |
|---|---|
| Aristolochiaceae | 4 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aristolochia curcurbitifolia | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| Aristolochia foveolata | 158544 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| Aristolochia pubescens | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| Aristolochia tubiflora | 12947 | Aristolochiaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL600828 |
CHEMBL1067148
(1)
CHEMBL1067154
(1)
|
0 / 0 |