| id | C00002792 | 
|---|---|
| Name | Anthragallol | 
| CAS RN | 602-64-2 | 
| Standard InChI | InChI=1S/C14H8O5/c15-9-5-8-10(14(19)13(9)18)12(17)7-4-2-1-3-6(7)11(8)16/h1-5,15,18-19H | 
| Standard InChI (Main Layer) | InChI=1S/C14H8O5/c15-9-5-8-10(14(19)13(9)18)12(17)7-4-2-1-3-6(7)11(8)16/h1-5,15,18-19H | 
| Phytochemical cluster | No. 62 | 
|---|---|
| KCF-S cluster | No. 41 | 
| By standard InChI | CHEMBL192032 | 
|---|---|
| By standard InChI Main Layer | CHEMBL192032 | 
| By LinkDB | C10297 | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Relbunium hypocarpium | 120148 | Rubiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | Other cytosolic protein | CHEMBL192032 | CHEMBL2188686
                        (1) | 0 / 0 | 
| P10415 | Apoptosis regulator Bcl-2 | Other cytosolic protein | CHEMBL192032 | CHEMBL2188685
                        (1) | 0 / 7 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00005 | Chronic lymphocytic leukemia (CLL) | P10415
                            (related) | 
| H00013 | Small cell lung cancer | P10415
                            (related) | 
| H00018 | Gastric cancer | P10415
                            (related) | 
| H00028 | Choriocarcinoma | P10415
                            (related) | 
| H00030 | Cervical cancer | P10415
                            (related) | 
| H00041 | Kaposi's sarcoma | P10415
                            (related) | 
| H00054 | Nasopharyngeal cancer | P10415
                            (related) |