id | C00028775 |
---|---|
Name | Oripavine |
CAS RN | 467-04-9 |
Standard InChI | InChI=1S/C18H19NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,12,17,20H,7-9H2,1-2H3/t12-,17+,18+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C18H19NO3/c1-19-8-7-18-11-4-6-14(21-2)17(18)22-16-13(20)5-3-10(15(16)18)9-12(11)19/h3-6,12,17,20H,7-9H2,1-2H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 1983 |
By standard InChI | CHEMBL437602 |
---|---|
By standard InChI Main Layer | CHEMBL437602 |
By LinkDB | C06175 |
---|
By CAS RN | C005283 |
---|
class name | count |
---|---|
eudicotyledons | 4 |
family name | count |
---|---|
Papaveraceae | 4 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Papaver bracteatum | 215227 | Papaveraceae | eudicotyledons | Viridiplantae |
Papaver macrantha | 3468 | Papaveraceae | eudicotyledons | Viridiplantae |
Papaver orientale L. | 22694 | Papaveraceae | eudicotyledons | Viridiplantae |
Papaver pinnatifidum | 3468 | Papaveraceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35372 | Mu-type opioid receptor | Opioid receptor | CHEMBL437602 |
CHEMBL925794
(1)
CHEMBL925795
(1)
CHEMBL925796 (1) |
0 / 0 |