| id | C00002878 |
|---|---|
| Name | Dihydropinosylvin / 3,5-Dihydroxybibenzyl |
| CAS RN | 14531-52-3 |
| Standard InChI | InChI=1S/C14H14O2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-5,8-10,15-16H,6-7H2 |
| Standard InChI (Main Layer) | InChI=1S/C14H14O2/c15-13-8-12(9-14(16)10-13)7-6-11-4-2-1-3-5-11/h1-5,8-10,15-16H,6-7H2 |
| Phytochemical cluster | No. 26 |
|---|---|
| KCF-S cluster | No. 242 |
| By standard InChI | CHEMBL228120 |
|---|---|
| By standard InChI Main Layer | CHEMBL228120 |
| By LinkDB | C10254 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Spermatophyta | 8 |
| Liliopsida | 5 |
| family name | count |
|---|---|
| Pinaceae | 8 |
| Dioscoreaceae | 4 |
| Stemonaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL228120 |
CHEMBL914259
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL228120 |
CHEMBL914258
(1)
|
0 / 0 |