| id | C00029284 |
|---|---|
| Name | (-)-Medioresinol |
| CAS RN | 125638-34-8 |
| Standard InChI | InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3/t13-,14-,20+,21+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H24O7/c1-24-16-6-11(4-5-15(16)22)20-13-9-28-21(14(13)10-27-20)12-7-17(25-2)19(23)18(8-12)26-3/h4-8,13-14,20-23H,9-10H2,1-3H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL376507 CHEMBL513023 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Piperaceae | 1 |
| Thymelaeaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Dirca occidentalis | 699060 | Thymelaeaceae | rosids | Viridiplantae |
| Peperomia duclouxii C. DC. | 13196 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL513023 |
CHEMBL970954
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL513023 |
CHEMBL970953
(1)
|
0 / 1 |