| id | C00029306 |
|---|---|
| Name | (+)-Rhododendrol |
| CAS RN | 59092-94-3 |
| Standard InChI | InChI=1S/C10H14O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-8,11-12H,2-3H2,1H3/t8-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H14O2/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-8,11-12H,2-3H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4115 |
| By standard InChI | CHEMBL1778763 |
|---|---|
| By standard InChI Main Layer | CHEMBL108014 CHEMBL1086681 CHEMBL1778763 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| Liliopsida | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Aceraceae | 1 |
| Zingiberaceae | 1 |
| Polygonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Acer nikoense | 171213 | Aceraceae | rosids | Viridiplantae |
| Curcuma comosa | 199633 | Zingiberaceae | Liliopsida | Viridiplantae |
| Rheum maximowiczii | 3620 | Polygonaceae | eudicotyledons | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL108014 |
CHEMBL1794401
(1)
|
0 / 0 |