| id | C00029346 |
|---|---|
| Name | (Z)-3-Hexenyl beta-D-glucopyranoside / (-)-(Z)-3-Hexenyl-beta-glucopyranoside / (Z)-3-Hexen-1-ol-beta-D-glucopyranoside |
| CAS RN | 95632-87-4 |
| Standard InChI | InChI=1S/C12H22O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h3-4,8-16H,2,5-7H2,1H3/b4-3-/t8-,9-,10+,11-,12-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C12H22O6/c1-2-3-4-5-6-17-12-11(16)10(15)9(14)8(7-13)18-12/h3-4,8-16H,2,5-7H2,1H3 |
| Phytochemical cluster | No. 73 |
|---|---|
| KCF-S cluster | No. 258 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL2152486 |
| By LinkDB |
|---|
| By CAS RN | C058860 |
|---|
| class name | count |
|---|---|
| asterids | 3 |
| family name | count |
|---|---|
| Lamiaceae | 2 |
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Bellis perennis | 41492 | Asteraceae | asterids | Viridiplantae |
| Clerodendrum inerme | 49994 | Lamiaceae | asterids | Viridiplantae |
| Mentha spicata | 29719 | Lamiaceae | asterids | Viridiplantae |