| id | C00029359 |
|---|---|
| Name | 1,3,7-Trihydroxy-2,4-di(3-methylbut-2-enyl)xanthone |
| CAS RN | 52601-11-3 |
| Standard InChI | InChI=1S/C23H24O5/c1-12(2)5-8-15-20(25)16(9-6-13(3)4)23-19(21(15)26)22(27)17-11-14(24)7-10-18(17)28-23/h5-7,10-11,24-26H,8-9H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C23H24O5/c1-12(2)5-8-15-20(25)16(9-6-13(3)4)23-19(21(15)26)22(27)17-11-14(24)7-10-18(17)28-23/h5-7,10-11,24-26H,8-9H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL1782240 |
|---|---|
| By standard InChI Main Layer | CHEMBL1782240 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cratoxylum cochinchinense | 271749 | Hypericaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL1782240 |
CHEMBL1785171
(1)
|
0 / 0 |