| id | C00029435 |
|---|---|
| Name | 2,4-Dihydroxybenzaldehyde |
| CAS RN | 95-01-2 |
| Standard InChI | InChI=1S/C7H6O3/c8-4-5-1-2-6(9)3-7(5)10/h1-4,9-10H |
| Standard InChI (Main Layer) | InChI=1S/C7H6O3/c8-4-5-1-2-6(9)3-7(5)10/h1-4,9-10H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2076 |
| By standard InChI | CHEMBL243587 |
|---|---|
| By standard InChI Main Layer | CHEMBL243587 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Orchidaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Gymnadenia conopsea R.BR. | 59323 | Orchidaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL243587 |
CHEMBL1099470
(1)
|
0 / 0 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL243587 |
CHEMBL2114738
(1)
|
0 / 0 |