| id | C00029471 |
|---|---|
| Name | 4-Hydroxydihydrocinnamic acid / 3-(4-Hydroxyphenyl)propionic acid |
| CAS RN | 501-97-3 |
| Standard InChI | InChI=1S/C9H10O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5,10H,3,6H2,(H,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C9H10O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5,10H,3,6H2,(H,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3466 |
| By standard InChI | CHEMBL1172560 |
|---|---|
| By standard InChI Main Layer | CHEMBL1172560 |
| By LinkDB | C01744 |
|---|
| By CAS RN | C008869 |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| rosids | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Malva silvestris | 96479 | Malvaceae | rosids | Viridiplantae |
| Persea americana | 3435 | Lauraceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P26358 | DNA (cytosine-5)-methyltransferase 1 | Transferase | CHEMBL1172560 |
CHEMBL2050426
(1)
|
2 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #604121 | Cerebellar ataxia, deafness, and narcolepsy, autosomal dominant; adcadn |
P26358
|
| #614116 | Neuropathy, hereditary sensory, type ie; hsn1e |
P26358
|