id | C00029471 |
---|---|
Name | 4-Hydroxydihydrocinnamic acid / 3-(4-Hydroxyphenyl)propionic acid |
CAS RN | 501-97-3 |
Standard InChI | InChI=1S/C9H10O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5,10H,3,6H2,(H,11,12) |
Standard InChI (Main Layer) | InChI=1S/C9H10O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-2,4-5,10H,3,6H2,(H,11,12) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 3466 |
By standard InChI | CHEMBL1172560 |
---|---|
By standard InChI Main Layer | CHEMBL1172560 |
By LinkDB | C01744 |
---|
By CAS RN | C008869 |
---|
class name | count |
---|---|
Magnoliophyta | 1 |
rosids | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Malva silvestris | 96479 | Malvaceae | rosids | Viridiplantae |
Persea americana | 3435 | Lauraceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P26358 | DNA (cytosine-5)-methyltransferase 1 | Transferase | CHEMBL1172560 |
CHEMBL2050426
(1)
|
2 / 0 |
OMIM | preferred title | UniProt |
---|---|---|
#604121 | Cerebellar ataxia, deafness, and narcolepsy, autosomal dominant; adcadn |
P26358
|
#614116 | Neuropathy, hereditary sensory, type ie; hsn1e |
P26358
|