| id | C00002951 |
|---|---|
| Name | Gartanin |
| CAS RN | 33390-42-0 |
| Standard InChI | InChI=1S/C23H24O6/c1-11(2)5-7-13-19(26)14(8-6-12(3)4)22-18(20(13)27)21(28)17-15(24)9-10-16(25)23(17)29-22/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C23H24O6/c1-11(2)5-7-13-19(26)14(8-6-12(3)4)22-18(20(13)27)21(28)17-15(24)9-10-16(25)23(17)29-22/h5-6,9-10,24-27H,7-8H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL487992 |
|---|---|
| By standard InChI Main Layer | CHEMBL487992 |
| By LinkDB | C10063 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| family name | count |
|---|---|
| Clusiaceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Garcinia dulcis | 231905 | Clusiaceae | rosids | Viridiplantae |
| Garcinia mangostana | 58228 | Clusiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL487992 |
CHEMBL1100043
(1)
|
0 / 0 |
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL487992 |
CHEMBL937818
(1)
|
2 / 2 |
| O14763 | Tumor necrosis factor receptor superfamily member 10B | Unclassified protein | CHEMBL487992 |
CHEMBL1104094
(1)
|
1 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL487992 |
CHEMBL1100041
(1)
|
0 / 0 |