| id | C00002953 |
|---|---|
| Name | Gentisein |
| CAS RN | 529-49-7 |
| Standard InChI | InChI=1S/C13H8O5/c14-6-1-2-10-8(3-6)13(17)12-9(16)4-7(15)5-11(12)18-10/h1-5,14-16H |
| Standard InChI (Main Layer) | InChI=1S/C13H8O5/c14-6-1-2-10-8(3-6)13(17)12-9(16)4-7(15)5-11(12)18-10/h1-5,14-16H |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 71 |
| By standard InChI | CHEMBL361025 |
|---|---|
| By standard InChI Main Layer | CHEMBL361025 |
| By LinkDB | C10065 |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Gentianaceae | 1 |
| Calophyllaceae | 1 |
| Hypericaceae | 1 |
| Polygalaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Gentiana lutea | 38851 | Gentianaceae | asterids | Viridiplantae |
| Haploclathra paniculata | 280743 | Calophyllaceae | rosids | Viridiplantae |
| Hypericum degenii | 55962 | Hypericaceae | rosids | Viridiplantae |
| Polygala caudata | 4275 | Polygalaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21397 | Amine oxidase [flavin-containing] A | Oxidoreductase | CHEMBL361025 |
CHEMBL827909
(1)
|
1 / 1 |
| P49327 | Fatty acid synthase | Transferase | CHEMBL361025 |
CHEMBL1260142
(1)
|
0 / 0 |