| id | C00029995 | 
|---|---|
| Name | Cochinchinone A | 
| CAS RN | 878755-43-2 | 
| Standard InChI | InChI=1S/C28H32O5/c1-16(2)7-6-8-18(5)10-13-21-25(30)20(12-9-17(3)4)26(31)24-27(32)22-15-19(29)11-14-23(22)33-28(21)24/h7,9-11,14-15,29-31H,6,8,12-13H2,1-5H3/b18-10+ | 
| Standard InChI (Main Layer) | InChI=1S/C28H32O5/c1-16(2)7-6-8-18(5)10-13-21-25(30)20(12-9-17(3)4)26(31)24-27(32)22-15-19(29)11-14-23(22)33-28(21)24/h7,9-11,14-15,29-31H,6,8,12-13H2,1-5H3 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 14 | 
| By standard InChI | CHEMBL1782241 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1782241 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| rosids | 1 | 
| family name | count | 
|---|---|
| Hypericaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Cratoxylum cochinchinense | 271749 | Hypericaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL1782241 | 
                        CHEMBL1785171
                        (1)
                         | 
                      0 / 0 |