| id | C00030359 |
|---|---|
| Name | Garcinone E |
| CAS RN | 112649-21-5 |
| Standard InChI | InChI=1S/C28H32O6/c1-14(2)7-10-17-20(29)13-21-23(24(17)30)27(33)22-18(11-8-15(3)4)25(31)26(32)19(28(22)34-21)12-9-16(5)6/h7-9,13,29-32H,10-12H2,1-6H3 |
| Standard InChI (Main Layer) | InChI=1S/C28H32O6/c1-14(2)7-10-17-20(29)13-21-23(24(17)30)27(33)22-18(11-8-15(3)4)25(31)26(32)19(28(22)34-21)12-9-16(5)6/h7-9,13,29-32H,10-12H2,1-6H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL454580 |
|---|---|
| By standard InChI Main Layer | CHEMBL454580 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Clusiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Garcina xipshuanbannaensis | ||||
| Garcinia mangostana | 58228 | Clusiaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P17861 | X-box-binding protein 1 | Unclassified protein | CHEMBL454580 |
CHEMBL1738682
(1)
|
1 / 0 |
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL454580 |
CHEMBL1738312
(1)
|
0 / 0 |
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL454580 |
CHEMBL2114784
(1)
|
1 / 1 |
| P06746 | DNA polymerase beta | Enzyme | CHEMBL454580 |
CHEMBL1614079
(1)
|
0 / 0 |
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL454580 |
CHEMBL1794585
(1)
|
0 / 0 |
| P49327 | Fatty acid synthase | Transferase | CHEMBL454580 |
CHEMBL1260142
(1)
|
0 / 0 |
| P54132 | Bloom syndrome protein | Enzyme | CHEMBL454580 |
CHEMBL1614067
(1)
|
1 / 2 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL454580 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL454580 |
CHEMBL2114843
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL454580 |
CHEMBL2114788
(1)
|
0 / 0 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL454580 |
CHEMBL2114810
(1)
CHEMBL2114817
(1)
|
7 / 3 |
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL454580 |
CHEMBL1794569
(1)
|
1 / 1 |
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL454580 |
CHEMBL937818
(1)
CHEMBL937820
(1)
CHEMBL937821 (1) |
2 / 2 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL454580 |
CHEMBL1614521
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL454580 |
CHEMBL1738588
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL454580 |
CHEMBL1794483
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL454580 |
CHEMBL1737991
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL454580 |
CHEMBL1614211
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL454580 |
CHEMBL1614421
(1)
CHEMBL1614502
(1)
|
4 / 3 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL454580 |
CHEMBL1738184
(1)
|
0 / 0 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL454580 |
CHEMBL1794536
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL454580 |
CHEMBL1613914
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL454580 |
CHEMBL2354311
(1)
|
1 / 0 |
| Q8IUX4 | DNA dC->dU-editing enzyme APOBEC-3F | Enzyme | CHEMBL454580 |
CHEMBL1963966
(1)
|
0 / 0 |
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL454580 |
CHEMBL2114913
(1)
|
0 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #613546 | Aromatase deficiency |
P11511
|
| #139300 | Aromatase excess syndrome; aexs |
P11511
|
| #210900 | Bloom syndrome; blm |
P54132
|
| #114500 | Colorectal cancer; crc |
P84022
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #137800 | Glioma susceptibility 1; glm1 |
O75874
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #612371 | Major affective disorder 7; mafd7 |
P17861
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #278750 | Xeroderma pigmentosum, variant type; xpv |
Q9Y253
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00081 | Hashimoto's thyroiditis |
P01215
(marker)
|
| H00082 | Graves' disease |
P01215
(marker)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P01215
(marker)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) |
P11511
(related)
|
| H00794 | Aromatase excess syndrome |
P11511
(related)
|
| H00094 | DNA repair defects |
P54132
(related)
|
| H00296 | Defects in RecQ helicases |
P54132
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|
| H00403 | Disorders of nucleotide excision repair |
Q9Y253
(related)
|