| id | C00003037 |
|---|---|
| Name | (R)-Citronellal / (R)-3,7-Dimethyl-6-octenal |
| CAS RN | 2385-77-5 |
| Standard InChI | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3/t10-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,8,10H,4,6-7H2,1-3H3 |
| Phytochemical cluster | No. 34 |
|---|---|
| KCF-S cluster | No. 1948 |
| By standard InChI | CHEMBL1081721 |
|---|---|
| By standard InChI Main Layer | CHEMBL1081721 |
| By LinkDB | C09848 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 2 |
| asterids | 2 |
| Liliopsida | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Citrus spp. | 2706 | Rutaceae | rosids | Viridiplantae |
| Cymbopogon nardus | 79840 | Poaceae | Liliopsida | Viridiplantae |
| Eucalyptus citriodora | 34329 | Myrtaceae | rosids | Viridiplantae |
| Melissa officinalis | 39338 | Lamiaceae | asterids | Viridiplantae |
| Ocimum gratissimum | 204144 | Lamiaceae | asterids | Viridiplantae |
| Phlebalium nudum |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1081721 |
CHEMBL1014033
(1)
|
0 / 3 |
| O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL1081721 |
CHEMBL1099470
(1)
|
0 / 0 |