| id | C00030466 |
|---|---|
| Name | Helicid / 4-(beta-D-glucopyranosyloxy) benzaldehyde |
| CAS RN | 80154-34-3 |
| Standard InChI | InChI=1S/C13H16O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-5,9-13,15-18H,6H2/t9-,10-,11-,12-,13-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C13H16O7/c14-5-7-1-3-8(4-2-7)19-13-12(18)11(17)10(16)9(6-15)20-13/h1-5,9-13,15-18H,6H2 |
| Phytochemical cluster | No. 72 |
|---|---|
| KCF-S cluster | No. 45 |
| By standard InChI | CHEMBL201358 |
|---|---|
| By standard InChI Main Layer | CHEMBL201358 CHEMBL461515 |
| By LinkDB |
|---|
| By CAS RN | C055677 |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Cucurbitaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Citrullus colocynthis (L.) | 3653 | Cucurbitaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51649 | Succinate-semialdehyde dehydrogenase, mitochondrial | Oxidoreductase | CHEMBL201358 |
CHEMBL867028
(1)
|
1 / 1 |
| P80404 | 4-aminobutyrate aminotransferase, mitochondrial | Transferase | CHEMBL201358 |
CHEMBL867027
(1)
|
1 / 1 |