id | C00030755 |
---|---|
Name | Methyl palmitate / Methyl hexadecanoate |
CAS RN | 112-39-0 |
Standard InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 793 |
By standard InChI | CHEMBL335125 |
---|---|
By standard InChI Main Layer | CHEMBL335125 |
By LinkDB | C16995 |
---|
By CAS RN | C019012 |
---|
class name | count |
---|---|
asterids | 2 |
rosids | 1 |
Magnoliophyta | 1 |
eudicotyledons | 1 |
family name | count |
---|---|
Asteraceae | 2 |
Brassicaceae | 1 |
Lauraceae | 1 |
Amaranthaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P34972 | Cannabinoid receptor 2 | Cannabinoid receptor | CHEMBL335125 |
CHEMBL657305
(1)
|
0 / 0 |
P21554 | Cannabinoid receptor 1 | Cannabinoid receptor | CHEMBL335125 |
CHEMBL657501
(1)
|
0 / 0 |