| id | C00003084 |
|---|---|
| Name | Ipolamiide |
| CAS RN | 27934-98-1 |
| Standard InChI | InChI=1S/C17H26O11/c1-16(23)3-4-17(24)7(13(22)25-2)6-26-15(12(16)17)28-14-11(21)10(20)9(19)8(5-18)27-14/h6,8-12,14-15,18-21,23-24H,3-5H2,1-2H3/t8?,9-,10+,11?,12-,14+,15+,16+,17+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H26O11/c1-16(23)3-4-17(24)7(13(22)25-2)6-26-15(12(16)17)28-14-11(21)10(20)9(19)8(5-18)27-14/h6,8-12,14-15,18-21,23-24H,3-5H2,1-2H3 |
| Phytochemical cluster | No. 36 |
|---|---|
| KCF-S cluster | No. 56 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C09784 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 5 |
| family name | count |
|---|---|
| Lamiaceae | 2 |
| Verbenaceae | 2 |
| Acanthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Barleria lupulina | 101743 | Acanthaceae | asterids | Viridiplantae |
| Lamium amplexicaule | 53160 | Lamiaceae | asterids | Viridiplantae |
| Phlomis aurea | 997702 | Lamiaceae | asterids | Viridiplantae |
| Stachytarpheta mutabilis | 925370 | Verbenaceae | asterids | Viridiplantae |
| Verbenoxylum reitzii | 21910 | Verbenaceae | asterids | Viridiplantae |