| id | C00030885 |
|---|---|
| Name | Odoratisol C / (-)-Odoratisol C |
| CAS RN | 891182-95-9 |
| Standard InChI | InChI=1S/C20H24O5/c1-11-12(2)20(14-6-8-16(22)18(10-14)24-4)25-19(11)13-5-7-15(21)17(9-13)23-3/h5-12,19-22H,1-4H3/t11-,12-,19-,20+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O5/c1-11-12(2)20(14-6-8-16(22)18(10-14)24-4)25-19(11)13-5-7-15(21)17(9-13)23-3/h5-12,19-22H,1-4H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL228326 CHEMBL1170325 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Lauraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Machilus odoratissima NEES | 251260 | Lauraceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL228326 |
CHEMBL890266
(1)
|
0 / 1 |