| id | C00031034 |
|---|---|
| Name | Piperonylic acid / 3,4-Methylenedioxybenzoic acid |
| CAS RN | 94-53-1 |
| Standard InChI | InChI=1S/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) |
| Standard InChI (Main Layer) | InChI=1S/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4093 |
| By standard InChI | CHEMBL573781 |
|---|---|
| By standard InChI Main Layer | CHEMBL573781 |
| By LinkDB |
|---|
| By CAS RN | C005455 |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Piperaceae | 1 |
| Begoniaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Begonia nantoensis | 78253 | Begoniaceae | rosids | Viridiplantae |
| Piper philippinum | 13215 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL573781 |
CHEMBL1614458
(1)
|
0 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL573781 |
CHEMBL1613808
(1)
|
0 / 0 |