| id | C00031034 | 
|---|---|
| Name | Piperonylic acid / 3,4-Methylenedioxybenzoic acid | 
| CAS RN | 94-53-1 | 
| Standard InChI | InChI=1S/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) | 
| Standard InChI (Main Layer) | InChI=1S/C8H6O4/c9-8(10)5-1-2-6-7(3-5)12-4-11-6/h1-3H,4H2,(H,9,10) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4093 | 
| By standard InChI | CHEMBL573781 | 
|---|---|
| By standard InChI Main Layer | CHEMBL573781 | 
| By LinkDB | 
|---|
| By CAS RN | C005455 | 
|---|
| class name | count | 
|---|---|
| Magnoliophyta | 1 | 
| rosids | 1 | 
| family name | count | 
|---|---|
| Piperaceae | 1 | 
| Begoniaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Begonia nantoensis | 78253 | Begoniaceae | rosids | Viridiplantae | 
| Piper philippinum | 13215 | Piperaceae | Magnoliophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL573781 | CHEMBL1614458
                        (1) | 0 / 0 | 
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL573781 | CHEMBL1613808
                        (1) | 0 / 0 |