| id | C00031117 | 
|---|---|
| Name | Quinidine / (+)-Quinidine | 
| CAS RN | 56-54-2 | 
| Standard InChI | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19+,20-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3 | 
| Phytochemical cluster | No. 7 | 
|---|---|
| KCF-S cluster | No. 1378 | 
| By standard InChI | CHEMBL1294 | 
|---|---|
| By standard InChI Main Layer | CHEMBL97 CHEMBL15088 CHEMBL21578 CHEMBL1294 CHEMBL170 CHEMBL387326 CHEMBL407725 CHEMBL512340 CHEMBL522505 CHEMBL460606 CHEMBL601807 CHEMBL576997 CHEMBL1358565 CHEMBL1364159 CHEMBL1616938 CHEMBL1741006 CHEMBL1878119 CHEMBL2355467 | 
| By LinkDB | C06527 | 
|---|
| By CAS RN | D011802 | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Cinchona pubescens | 50278 | Rubiaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL97 CHEMBL21578 CHEMBL387326 CHEMBL512340 CHEMBL601807 | CHEMBL663531
                        (2)
                        CHEMBL729201
                        (2) CHEMBL729206 (4) CHEMBL758056 (2) CHEMBL754768 (1) CHEMBL828928 (1) CHEMBL827154 (1) CHEMBL860948 (1) CHEMBL860702 (1) CHEMBL856833 (1) CHEMBL930258 (1) CHEMBL1002237 (1) CHEMBL971601 (1) CHEMBL1028886 (1) CHEMBL1028887 (1) CHEMBL956235 (1) CHEMBL970954 (1) CHEMBL989847 (1) CHEMBL1000806 (1) CHEMBL960164 (1) CHEMBL960165 (1) CHEMBL1614110 (3) CHEMBL1664606 (1) CHEMBL1669910 (1) CHEMBL1741321 (2) CHEMBL1743281 (1) CHEMBL1768376 (1) CHEMBL2071965 (1) | 1 / 0 | 
| Q9Y6L6 | Solute carrier organic anion transporter family member 1B1 | Electrochemical transporter | CHEMBL21578 CHEMBL387326 | CHEMBL2077604
                        (1)
                        CHEMBL2169429
                        (2) | 1 / 0 | 
| O15244 | Solute carrier family 22 member 2 | Drug uniporter | CHEMBL21578 CHEMBL387326 | CHEMBL1743168
                        (1)
                        CHEMBL2076311
                        (1) CHEMBL2076808 (1) CHEMBL2077781 (1) CHEMBL2077782 (1) CHEMBL2077813 (1) | 0 / 0 | 
| O94956 | Solute carrier organic anion transporter family member 2B1 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL2169431
                        (2) | 0 / 0 | 
| Q96FL8 | Multidrug and toxin extrusion protein 1 | Cation antiporter | CHEMBL21578 | CHEMBL1743174
                        (1)
                        CHEMBL2320305
                        (1) CHEMBL2320306 (1) | 0 / 0 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1294 CHEMBL522505 CHEMBL1358565 | CHEMBL1794367
                        (2)
                        CHEMBL2114784
                        (3) | 1 / 1 | 
| O95342 | Bile salt export pump | drug | CHEMBL21578 | CHEMBL2076226
                        (1) | 2 / 1 | 
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL21578 CHEMBL1294 | CHEMBL766814
                        (1)
                        CHEMBL829152
                        (1) CHEMBL954102 (1) CHEMBL1794573 (1) CHEMBL1817375 (1) | 2 / 2 | 
| O15245 | Solute carrier family 22 member 1 | Drug uniporter | CHEMBL21578 CHEMBL387326 | CHEMBL993349
                        (2)
                        CHEMBL994103
                        (2) CHEMBL1743171 (2) CHEMBL2076306 (1) CHEMBL2076307 (1) CHEMBL2076204 (1) CHEMBL2076233 (2) CHEMBL2077747 (1) CHEMBL2077760 (1) CHEMBL2077761 (1) | 0 / 0 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL387326 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL97 CHEMBL1294 | CHEMBL1614281
                        (1)
                        CHEMBL1614361
                        (2) | 3 / 2 | 
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL387326 | CHEMBL1613776
                        (1) | 3 / 1 | 
| P02768 | Serum albumin | Secreted protein | CHEMBL21578 CHEMBL387326 | CHEMBL646315
                        (1)
                        CHEMBL702885
                        (2) CHEMBL925737 (1) | 0 / 0 | 
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL21578 CHEMBL387326 | CHEMBL754774
                        (1)
                        CHEMBL755181
                        (2) CHEMBL753510 (2) CHEMBL753511 (2) CHEMBL755826 (1) CHEMBL755827 (1) CHEMBL754160 (1) CHEMBL754161 (1) CHEMBL1743176 (1) CHEMBL1908285 (1) CHEMBL1908286 (1) CHEMBL1908289 (1) CHEMBL1908291 (1) CHEMBL1908292 (1) CHEMBL2049767 (1) CHEMBL2077111 (1) CHEMBL2076084 (1) CHEMBL2076085 (1) CHEMBL2076687 (1) CHEMBL2076716 (1) CHEMBL2077350 (1) CHEMBL2075168 (1) CHEMBL2076146 (1) CHEMBL2075700 (1) CHEMBL2075701 (1) CHEMBL2076415 (1) CHEMBL2076420 (1) CHEMBL2076583 (1) CHEMBL2076595 (1) CHEMBL2076205 (1) CHEMBL2076207 (1) CHEMBL2076209 (1) CHEMBL2076213 (2) CHEMBL2076214 (2) CHEMBL2076218 (2) CHEMBL2076231 (1) CHEMBL2076250 (1) CHEMBL2076251 (1) CHEMBL2076066 (1) CHEMBL2078125 (1) CHEMBL2078150 (1) CHEMBL2078544 (1) CHEMBL2078545 (1) CHEMBL2078546 (1) CHEMBL2078547 (1) CHEMBL2078576 (1) | 1 / 0 | 
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL97 CHEMBL21578 | CHEMBL661229
                        (1)
                        CHEMBL1028883
                        (1) CHEMBL1741325 (2) CHEMBL2071963 (1) | 0 / 1 | 
| O15296 | Arachidonate 15-lipoxygenase B | Enzyme | CHEMBL97 | CHEMBL1613800
                        (2) | 0 / 0 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL1294 CHEMBL460606 | CHEMBL1614458
                        (2) | 0 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL387326 | CHEMBL2114780
                        (1) | 0 / 0 | 
| Q8TCC7 | Solute carrier family 22 member 8 | Antiporter | CHEMBL21578 | CHEMBL2076658
                        (1) | 0 / 0 | 
| P46721 | Solute carrier organic anion transporter family member 1A2 | Unclassified protein | CHEMBL21578 | CHEMBL2077102
                        (1)
                        CHEMBL2076550
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1294 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL522505 | CHEMBL1738610
                        (1) | 0 / 0 | 
| Q9NPD5 | Solute carrier organic anion transporter family member 1B3 | Electrochemical transporter | CHEMBL21578 CHEMBL387326 | CHEMBL2169430
                        (2) | 1 / 0 | 
| P11021 | 78 kDa glucose-regulated protein | Unclassified protein | CHEMBL97 | CHEMBL1963893
                        (1) | 0 / 0 | 
| P37231 | Peroxisome proliferator-activated receptor gamma | NR1C3 | CHEMBL1294 | CHEMBL1794510
                        (1) | 5 / 3 | 
| P06276 | Cholinesterase | Hydrolase | CHEMBL21578 | CHEMBL2166019
                        (1) | 0 / 0 | 
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL97 CHEMBL21578 | CHEMBL1741322
                        (2)
                        CHEMBL2071962
                        (1) | 0 / 0 | 
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL97 CHEMBL460606 | CHEMBL1613910
                        (2) | 3 / 3 | 
| Q92887 | Canalicular multispecific organic anion transporter 1 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL1006005
                        (2)
                        CHEMBL2075102
                        (1) | 1 / 1 | 
| Q86VL8 | Multidrug and toxin extrusion protein 2 | Cation antiporter | CHEMBL21578 | CHEMBL1743175
                        (1) | 0 / 0 | 
| Q14524 | Sodium channel protein type 5 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 | CHEMBL905110
                        (1) | 9 / 7 | 
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL97 CHEMBL21578 | CHEMBL1028884
                        (1)
                        CHEMBL1741323
                        (2) CHEMBL2071964 (1) | 1 / 1 | 
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL97 CHEMBL21578 CHEMBL1294 CHEMBL387326 CHEMBL460606 | CHEMBL664809
                        (1)
                        CHEMBL836230
                        (1) CHEMBL1028885 (1) CHEMBL1614108 (3) CHEMBL1613886 (3) CHEMBL1741324 (2) CHEMBL1743273 (2) CHEMBL2071966 (1) CHEMBL2071967 (1) | 0 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1878119 | CHEMBL1794483
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1294 | CHEMBL2114890
                        (1) | 0 / 0 | 
| P22460 | Potassium voltage-gated channel subfamily A member 5 | KCNA, Kv1.x (Shaker) | CHEMBL21578 | CHEMBL905111
                        (1) | 1 / 1 | 
| P04156 | Major prion protein | Surface antigen | CHEMBL21578 | CHEMBL2155230
                        (1) | 6 / 2 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL1364159 | CHEMBL1794536
                        (1) | 0 / 0 | 
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL460606 | CHEMBL1613914
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL522505 | CHEMBL1738442
                        (1) | 0 / 0 | 
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL1294 | CHEMBL1614364
                        (1) | 1 / 1 | 
| O00255 | Menin | Unclassified protein | CHEMBL460606 | CHEMBL1614531
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL460606 | CHEMBL1614531
                        (1) | 1 / 3 | 
| Q9H015 | Solute carrier family 22 member 4 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL2077088
                        (1)
                        CHEMBL2076152
                        (1) CHEMBL2076153 (1) | 1 / 1 | 
| O76082 | Solute carrier family 22 member 5 | Unclassified protein | CHEMBL21578 CHEMBL387326 | CHEMBL2076256
                        (1)
                        CHEMBL2078104
                        (1) CHEMBL2078105 (1) | 1 / 2 | 
| Q9NY46 | Sodium channel protein type 3 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 CHEMBL387326 | CHEMBL806152
                        (2)
                        CHEMBL806153
                        (2) | 0 / 0 | 
| Q99250 | Sodium channel protein type 2 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 CHEMBL387326 | CHEMBL806152
                        (2)
                        CHEMBL806153
                        (2) | 2 / 2 | 
| P35498 | Sodium channel protein type 1 subunit alpha | SCN alpha, NaV1.x | CHEMBL21578 CHEMBL387326 | CHEMBL806152
                        (2)
                        CHEMBL806153
                        (2) | 3 / 2 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| D011802 | 5243 | ABCB1 ABC20 CD243 CLCS GP170 MDR1 P-GP PGY1 | ATP-binding cassette, sub-family B (MDR/TAP), member 1 (EC:3.6.3.44) | ABCB1 protein affects the transport of Quinidine | affects transport | protein | 15616150 | 
| D011802 | 5243 | ABCB1 ABC20 CD243 CLCS GP170 MDR1 P-GP PGY1 | ATP-binding cassette, sub-family B (MDR/TAP), member 1 (EC:3.6.3.44) | Quinidine inhibits the reaction [ABCB1 protein results in decreased susceptibility to docetaxel] | decreases reaction / decreases response to substance | protein | 20196146 | 
| D011802 | 5243 | ABCB1 ABC20 CD243 CLCS GP170 MDR1 P-GP PGY1 | ATP-binding cassette, sub-family B (MDR/TAP), member 1 (EC:3.6.3.44) | Quinidine inhibits the reaction [ABCB1 protein results in decreased susceptibility to Paclitaxel] | decreases reaction / decreases response to substance | protein | 20196146 | 
| D011802 | 5243 | ABCB1 ABC20 CD243 CLCS GP170 MDR1 P-GP PGY1 | ATP-binding cassette, sub-family B (MDR/TAP), member 1 (EC:3.6.3.44) | Quinidine results in decreased expression of ABCB1 protein | decreases expression | protein | 20196146 | 
| D011802 | 148 | ADRA1A ADRA1C ADRA1L1 ALPHA1AAR | adrenoceptor alpha 1A | Quinidine binds to ADRA1A protein | affects binding | protein | 9570190 | 
| D011802 | 148 | ADRA1A ADRA1C ADRA1L1 ALPHA1AAR | adrenoceptor alpha 1A | [Quinidine co-treated with Verapamil] inhibits the reaction [ADRA1A protein results in increased abundance of Inositol 1,4,5-Trisphosphate] | affects cotreatment / decreases reaction / increases abundance | protein | 9570190 | 
| D011802 | 148 | ADRA1A ADRA1C ADRA1L1 ALPHA1AAR | adrenoceptor alpha 1A | Quinidine inhibits the reaction [ADRA1A protein results in increased abundance of Inositol 1,4,5-Trisphosphate] | decreases reaction / increases abundance | protein | 9570190 | 
| D011802 | 147 | ADRA1B ADRA1 ALPHA1BAR | adrenoceptor alpha 1B | Quinidine binds to ADRA1B protein | affects binding | protein | 9570190 | 
| D011802 | 147 | ADRA1B ADRA1 ALPHA1BAR | adrenoceptor alpha 1B | [Quinidine co-treated with Verapamil] inhibits the reaction [ADRA1B protein results in increased abundance of Inositol 1,4,5-Trisphosphate] | affects cotreatment / decreases reaction / increases abundance | protein | 9570190 | 
| D011802 | 147 | ADRA1B ADRA1 ALPHA1BAR | adrenoceptor alpha 1B | Quinidine inhibits the reaction [ADRA1B protein results in increased abundance of Inositol 1,4,5-Trisphosphate] | decreases reaction / increases abundance | protein | 9570190 | 
| D011802 | 146 | ADRA1D ADRA1 ADRA1A ADRA1R ALPHA1 DAR dJ779E11.2 | adrenoceptor alpha 1D | Quinidine binds to ADRA1D protein | affects binding | protein | 9570190 | 
| D011802 | 146 | ADRA1D ADRA1 ADRA1A ADRA1R ALPHA1 DAR dJ779E11.2 | adrenoceptor alpha 1D | [Quinidine co-treated with Verapamil] inhibits the reaction [ADRA1D protein results in increased abundance of Inositol 1,4,5-Trisphosphate] | affects cotreatment / decreases reaction / increases abundance | protein | 9570190 | 
| D011802 | 146 | ADRA1D ADRA1 ADRA1A ADRA1R ALPHA1 DAR dJ779E11.2 | adrenoceptor alpha 1D | Quinidine inhibits the reaction [ADRA1D protein results in increased abundance of Inositol 1,4,5-Trisphosphate] | decreases reaction / increases abundance | protein | 9570190 | 
| D011802 | 440 | ASNS TS11 | asparagine synthetase (glutamine-hydrolyzing) (EC:6.3.5.4) | Quinidine results in increased expression of ASNS mRNA | increases expression | mRNA | 15342952 | 
| D011802 | 11067 | C10orf10 DEPP FIG | chromosome 10 open reading frame 10 | Quinidine results in increased expression of C10ORF10 mRNA | increases expression | mRNA | 17567588 | 
| D011802 | 1026 | CDKN1A CAP20 CDKN1 CIP1 MDA-6 P21 SDI1 WAF1 p21CIP1 | cyclin-dependent kinase inhibitor 1A (p21, Cip1) | Quinidine results in increased expression of CDKN1A protein | increases expression | protein | 12243503 | 
| D011802 | 1543 | CYP1A1 AHH AHRR CP11 CYP1 P1-450 P450-C P450DX | cytochrome P450, family 1, subfamily A, polypeptide 1 (EC:1.14.14.1) | Quinidine inhibits the reaction [Tetrachlorodibenzodioxin results in increased activity of CYP1A1 protein] | decreases reaction / increases activity | protein | 18493746 | 
| D011802 | 1544 | CYP1A2 CP12 P3-450 P450(PA) | cytochrome P450, family 1, subfamily A, polypeptide 2 (EC:1.14.14.1) | Quinidine affects the reaction [CYP1A2 protein results in increased oxidation of 4-amino-2-phenoxymethanesulfonanilide] | affects reaction / increases oxidation | protein | 19053182 | 
| D011802 | 1544 | CYP1A2 CP12 P3-450 P450(PA) | cytochrome P450, family 1, subfamily A, polypeptide 2 (EC:1.14.14.1) | Quinidine results in decreased activity of CYP1A2 protein | decreases activity | protein | 15916432 | 
| D011802 | 1557 | CYP2C19 CPCJ CYP2C P450C2C P450IIC19 | cytochrome P450, family 2, subfamily C, polypeptide 19 (EC:1.14.13.48 1.14.13.49 1.14.13.80) | Quinidine affects the reaction [CYP2C19 protein results in increased oxidation of 4-amino-2-phenoxymethanesulfonanilide] | affects reaction / increases oxidation | protein | 19053182 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | CYP2D6 protein results in increased metabolism of Quinidine | increases metabolic processing | protein | 17702393 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine inhibits the reaction [3-(2-(N,N-diethyl-N-methylammonium)ethyl)-7-methoxy-4-methylcoumarin results in increased metabolism of CYP2D6 protein] | decreases reaction / increases metabolic processing | protein | 20345925 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine inhibits the reaction [CYP2D6 protein affects the metabolism of 1-(3-chlorophenyl)piperazine] | affects metabolic processing / decreases reaction | protein | 18238857 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine inhibits the reaction [CYP2D6 protein results in increased hydrolysis of bufuralol] | decreases reaction / increases hydrolysis | protein | 11377097 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine inhibits the reaction [CYP2D6 protein results in increased metabolism of bufuralol] | decreases reaction / increases metabolic processing | protein | 12569440 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine inhibits the reaction [CYP2D6 protein results in increased metabolism of tegaserod] | decreases reaction / increases metabolic processing | protein | 11560869 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine inhibits the reaction [CYP2D6 protein results in increased metabolism of YM 758] | decreases reaction / increases metabolic processing | protein | 19230594 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine results in decreased activity of CYP2D6 gene mutant form | decreases activity | gene | 11673748 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | Quinidine results in decreased activity of CYP2D6 protein | decreases activity | protein | 8819299 12464242 12467917 12814958 15155557 15306208 15860655 16035375 19328226 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | [Quinidine results in decreased activity of CYP2D6 protein] which affects the susceptibility to Oxycodone | affects response to substance / decreases activity | protein | 20590588 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | [Quinidine results in decreased activity of CYP2D6 protein] which results in decreased chemical synthesis of 16-O-demethylaconitine | decreases activity / decreases chemical synthesis | protein | 21277363 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | [Quinidine results in decreased activity of CYP2D6 protein] which results in decreased chemical synthesis of 4-hydroxy-N-desmethyltamoxifen | decreases activity / decreases chemical synthesis | protein | 14652237 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | [Quinidine results in decreased activity of CYP2D6 protein] which results in decreased chemical synthesis of Aconitine metabolite | decreases activity / decreases chemical synthesis | protein | 21277363 | 
| D011802 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | [Quinidine results in decreased activity of CYP2D6 protein] which results in decreased hydroxylation of N-desmethyltamoxifen | decreases activity / decreases hydroxylation | protein | 14652237 | 
| D011802 | 1576 | CYP3A4 CP33 CP34 CYP3A CYP3A3 CYPIIIA3 CYPIIIA4 HLP NF-25 P450C3 P450PCN1 | cytochrome P450, family 3, subfamily A, polypeptide 4 (EC:1.14.13.67 1.14.13.97 1.14.13.32 1.14.13.157) | CYP3A4 protein affects the metabolism of Quinidine | affects metabolic processing | protein | 2271712 15784650 | 
| D011802 | 1576 | CYP3A4 CP33 CP34 CYP3A CYP3A3 CYPIIIA3 CYPIIIA4 HLP NF-25 P450C3 P450PCN1 | cytochrome P450, family 3, subfamily A, polypeptide 4 (EC:1.14.13.67 1.14.13.97 1.14.13.32 1.14.13.157) | Quinidine inhibits the reaction [CYP3A4 protein results in increased metabolism of YM 758] | decreases reaction / increases metabolic processing | protein | 19230594 | 
| D011802 | 2168 | FABP1 FABPL L-FABP | fatty acid binding protein 1, liver | Quinidine results in increased expression of FABP1 mRNA | increases expression | mRNA | 17567588 | 
| D011802 | 2944 | GSTM1 GST1 GSTM1-1 GSTM1a-1a GSTM1b-1b GTH4 GTM1 H-B MU MU-1 | glutathione S-transferase mu 1 (EC:2.5.1.18) | Quinidine results in decreased activity of GSTM1 protein | decreases activity | protein | 11807801 | 
| D011802 | 2950 | GSTP1 DFN7 FAEES3 GST3 GSTP PI | glutathione S-transferase pi 1 (EC:2.5.1.18) | Quinidine inhibits the reaction [GSTP1 protein affects the metabolism of and results in decreased activity of Ethacrynic Acid] | affects metabolic processing / decreases activity / decreases reaction | protein | 11807801 | 
| D011802 | 2950 | GSTP1 DFN7 FAEES3 GST3 GSTP PI | glutathione S-transferase pi 1 (EC:2.5.1.18) | Quinidine results in decreased activity of GSTP1 protein | decreases activity | protein | 11807801 | 
| D011802 | 3479 | IGF1 IGF-I IGF1A IGFI | insulin-like growth factor 1 (somatomedin C) | Quinidine inhibits the reaction [IGF1 protein results in increased activity of KCNH1 protein] | decreases reaction / increases activity | protein | 17520698 | 
| D011802 | 83729 | INHBE | inhibin, beta E | Quinidine results in increased expression of INHBE mRNA | increases expression | mRNA | 15342952 | 
| D011802 | 3756 | KCNH1 EAG EAG1 Kv10.1 h-eag | potassium voltage-gated channel, subfamily H (eag-related), member 1 | Quinidine inhibits the reaction [IGF1 protein results in increased activity of KCNH1 protein] | decreases reaction / increases activity | protein | 17520698 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Acids inhibits the reaction [Quinidine results in decreased activity of KCNH2 protein] | decreases activity / decreases reaction | protein | 15821840 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | KCNH2 gene mutant form results in decreased susceptibility to Quinidine | decreases response to substance | gene | 15673388 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | KCNH2 gene SNP affects the susceptibility to Quinidine | affects response to substance | gene | 12695533 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | naringenin promotes the reaction [Quinidine results in decreased activity of KCNH2 protein] | decreases activity / increases reaction | protein | 18057881 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Potassium inhibits the reaction [Quinidine results in decreased activity of KCNH2 protein] | decreases activity / decreases reaction | protein | 16960444 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinidine affects the activity of KCNH2 protein | affects activity | protein | 22020101 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinidine affects the localization of KCNH2 protein mutant form | affects localization | protein | 11741928 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinidine binds to KCNH2 protein | affects binding | protein | 18701618 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinidine inhibits the reaction [KCNH2 protein results in increased transport of Thallium] | decreases reaction / increases transport | protein | 19583963 21158687 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinidine promotes the reaction [naringenin results in decreased activity of KCNH2 protein] | decreases activity / increases reaction | protein | 18057881 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | Quinidine results in decreased activity of KCNH2 protein | decreases activity | protein | 11741928 12695533 15671647 15673388 15821840 16960444 17042915 18057881 18724381 21362439 | 
| D011802 | 3757 | KCNH2 ERG1 HERG HERG1 Kv11.1 LQT2 SQT1 | potassium voltage-gated channel, subfamily H (eag-related), member 2 | [Quinidine results in decreased activity of KCNH2 protein] which results in decreased import of Thallium | decreases activity / decreases import | protein | 21362439 | 
| D011802 | 338567 | KCNK18 K2p18.1 MGR13 TRESK TRESK-2 TRESK2 TRIK | potassium channel, subfamily K, member 18 | Quinidine inhibits the reaction [KCNK18 protein results in increased transport of Potassium] | decreases reaction / increases transport | protein | 12754259 | 
| D011802 | 26471 | NUPR1 COM1 P8 | nuclear protein, transcriptional regulator, 1 | Quinidine results in increased expression of NUPR1 mRNA | increases expression | mRNA | 17567588 | 
| D011802 | 6580 | SLC22A1 HOCT1 OCT1 oct1_cds | solute carrier family 22 (organic cation transporter), member 1 | Quinidine inhibits the reaction [SLC22A1 protein results in increased uptake of 1-Methyl-4-phenylpyridinium] | decreases reaction / increases uptake | protein | 16141367 | 
| D011802 | 6582 | SLC22A2 OCT2 | solute carrier family 22 (organic cation transporter), member 2 | Quinidine inhibits the reaction [SLC22A2 protein results in increased uptake of 1-Methyl-4-phenylpyridinium] | decreases reaction / increases uptake | protein | 16141367 | 
| D011802 | 6581 | SLC22A3 EMT EMTH OCT3 | solute carrier family 22 (organic cation transporter), member 3 | Quinidine inhibits the reaction [SLC22A3 protein results in increased uptake of 1-Methyl-4-phenylpyridinium] | decreases reaction / increases uptake | protein | 16141367 | 
| D011802 | 6515 | SLC2A3 GLUT3 | solute carrier family 2 (facilitated glucose transporter), member 3 | Quinidine results in decreased expression of SLC2A3 mRNA | decreases expression | mRNA | 15342952 17567588 | 
| D011802 | 55244 | SLC47A1 MATE1 | solute carrier family 47 (multidrug and toxin extrusion), member 1 | Quinidine results in decreased activity of SLC47A1 protein | decreases activity | protein | 16928787 | 
| D011802 | 6876 | TAGLN SM22 SMCC TAGLN1 WS3-10 | transgelin | Quinidine results in decreased expression of TAGLN mRNA | decreases expression | mRNA | 17567588 | 
| D011802 | 943 | TNFRSF8 CD30 D1S166E Ki-1 | tumor necrosis factor receptor superfamily, member 8 | Quinidine results in decreased expression of TNFRSF8 protein | decreases expression | protein | 12441127 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency | Q99714 | 
| #614022 | Atrial fibrillation, familial, 10; atfb10 | Q14524 | 
| #612240 | Atrial fibrillation, familial, 7; atfb7 | P22460 | 
| #108770 | Atrial standstill | Q14524 | 
| %606641 | Body mass index; bmi | P37231 | 
| #601144 | Brugada syndrome 1; brgda1 | Q14524 | 
| #601154 | Cardiomyopathy, dilated, 1e; cmd1e | Q14524 | 
| #212140 | Carnitine deficiency, systemic primary; cdsp | O76082 | 
| #609338 | Carotid intimal medial thickness 1 | P37231 | 
| #605479 | Cholestasis, benign recurrent intrahepatic, 2; bric2 | O95342 | 
| #601847 | Cholestasis, progressive familial intrahepatic, 2; pfic2 | O95342 | 
| #123400 | Creutzfeldt-jakob disease; cjd | P04156 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #607208 | Dravet syndrome | P35498 | 
| #609535 | Drug metabolism, poor, cyp2c19-related | P33261 | 
| #608902 | Drug metabolism, poor, cyp2d6-related | P10635 | 
| #237500 | Dubin-johnson syndrome; djs | Q92887 | 
| #613721 | Epileptic encephalopathy, early infantile, 11; eiee11 | Q99250 | 
| #600072 | Fatal familial insomnia; ffi | P04156 | 
| #604403 | Generalized epilepsy with febrile seizures plus, type 2; gefsp2 | P35498 | 
| #137440 | Gerstmann-straussler disease; gsd | P04156 | 
| #137800 | Glioma susceptibility 1; glm1 | P37231 | 
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #603218 | Huntington disease-like 1; hdl1 | P04156 | 
| #237450 | Hyperbilirubinemia, rotor type; hblrr | Q9NPD5 Q9Y6L6 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #603373 | Hyperthyroidism, familial gestational | P16473 | 
| #609152 | Hyperthyroidism, nonautoimmune | P16473 | 
| #275200 | Hypothyroidism, congenital, nongoitrous, 1; chng1 | P16473 | 
| #612244 | Inflammatory bowel disease 13; ibd13 | P08183 | 
| #245300 | Kuru, susceptibility to | P04156 | 
| #604367 | Lipodystrophy, familial partial, type 3; fpld3 | P37231 | 
| #613688 | Long qt syndrome 2; lqt2 | Q12809 | 
| #603830 | Long qt syndrome 3; lqt3 | Q14524 | 
| #300705 | Mental retardation, x-linked 17; mrx17 | Q99714 | 
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 | Q99714 | 
| #609634 | Migraine, familial hemiplegic, 3; fhm3 | P35498 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| #601665 | Obesity | P37231 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #113900 | Progressive familial heart block, type ia; pfhb1a | Q14524 | 
| #180300 | Rheumatoid arthritis; ra | Q9H015 | 
| #607745 | Seizures, benign familial infantile, 3; bfis3 | Q99250 | 
| #609620 | Short qt syndrome 1; sqt1 | Q12809 | 
| #608567 | Sick sinus syndrome 1, autosomal recessive; sss1 | Q14524 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 | Q9NUW8 | 
| #606688 | Spongiform encephalopathy with neuropsychiatric features | P04156 | 
| #272120 | Sudden infant death syndrome | Q14524 | 
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth | P10828 | 
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth | P10828 | 
| #145650 | Thyroid hormone resistance, selective pituitary; prth | P10828 | 
| #603829 | Ventricular fibrillation during myocardial infarction, susceptibility to | Q14524 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00286 | Crohn's disease | O76082
                            (related) Q9H015 (related) | 
| H00525 | Disorders of fatty-acid oxidation | O76082
                            (related) | 
| H00624 | Familial cholestasis | O95342
                            (related) | 
| H00061 | Prion diseases | P04156
                            (related) | 
| H01243 | Huntington's disease-like syndrome | P04156
                            (related) | 
| H00036 | Osteosarcoma | P08684
                            (marker) | 
| H00249 | Thyroid hormone resistance syndrome | P10828
                            (related) | 
| H01205 | Coumarin resistance | P11712
                            (related) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P16473
                            (related) | 
| H01269 | Congenital hyperthyroidism | P16473
                            (related) | 
| H00731 | Atrial fibrillation | P22460
                            (related) Q14524 (related) | 
| H01171 | Poor drug metabolism (PM) | P33261
                            (related) | 
| H00775 | Familial or sporadic hemiplegic migraine | P35498
                            (related) | 
| H00783 | Febrile seizures | P35498
                            (related) | 
| H00032 | Thyroid cancer | P37231
                            (related) | 
| H00409 | Type II diabetes mellitus | P37231
                            (related) | 
| H00420 | Familial partial lipodystrophy (FPL) | P37231
                            (related) | 
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) | 
| H00720 | Long QT syndrome | Q12809
                            (related) Q14524 (related) | 
| H00725 | Short QT syndrome | Q12809
                            (related) | 
| H00294 | Dilated cardiomyopathy (DCM) | Q14524
                            (related) | 
| H00728 | Brugada syndrome (BRS) | Q14524
                            (related) | 
| H00729 | Sick sinus syndrome (SSS) | Q14524
                            (related) | 
| H00730 | Familial idiopathic ventricular fibrillation | Q14524
                            (related) | 
| H01263 | Progressive cardiac conduction defect (PCCD) | Q14524
                            (related) | 
| H00208 | Hyperbilirubinemia | Q92887
                            (related) | 
| H00606 | Early infantile epileptic encephalopathy | Q99250
                            (related) | 
| H00806 | Benign familial neonatal and infantile epilepsies | Q99250
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) Q9NUW8 (related) | 
| H00480 | Non-syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00658 | Syndromic X-linked mental retardation | Q99714
                            (related) | 
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency | Q99714
                            (related) | 
| MeSH disease | OMIM | compound | disease name | evidence type | reference pmid | 
|---|---|---|---|---|---|
| D058186 | D011802 | Acute Kidney Injury | marker/mechanism | 3340030 | |
| D000380 | D011802 | Agranulocytosis | marker/mechanism | 6071731 | |
| D000741 | D011802 | Anemia, Aplastic | marker/mechanism | 6071731 | |
| D000743 | D011802 | Anemia, Hemolytic | marker/mechanism | 331400 644643 760860 4695590 7197395 17381629 | |
| D000744 | D011802 | Anemia, Hemolytic, Autoimmune | marker/mechanism | 126834 | |
| D001145 | D011802 | Arrhythmias, Cardiac | marker/mechanism therapeutic | 4857 63370 331400 504930 832287 1209009 1700225 2726785 3498356 3571742 3630896 3928042 4817707 6123639 6340187 6623464 6861988 7509896 12804730 17805561 18057881 18724381 19498275 21693436 | |
| D001168 | D011802 | Arthritis | marker/mechanism | 7211571 | |
| D001281 | D011802 | Atrial Fibrillation | marker/mechanism therapeutic | 504930 646873 654225 1388328 1507842 1514492 3716982 4635436 4716727 6695683 7468313 7653451 8187370 8311367 8465724 8607392 8772625 9165569 10942753 15837031 16615278 17523411 | |
| D001282 | D011802 | Atrial Flutter | marker/mechanism therapeutic | 3716982 6633588 6695683 6704857 7468313 8957602 | |
| D054537 | D011802 | Atrioventricular Block | therapeutic | 2444941 | |
| D001919 | D011802 | Bradycardia | marker/mechanism | 590302 15837031 | |
| D002493 | D011802 | Central Nervous System Diseases | marker/mechanism | 3318368 | |
| D002779 | D011802 | Cholestasis | marker/mechanism | 6704857 | |
| D015267 | D011802 | Churg-Strauss Syndrome | marker/mechanism | 3340030 | |
| D003072 | D011802 | Cognition Disorders | marker/mechanism | 2381359 8134536 | |
| D003117 | D011802 | Color Vision Defects | marker/mechanism | 7283806 | |
| D003324 | D011802 | Coronary Artery Disease | therapeutic | 758516 | |
| D023921 | D011802 | Coronary Stenosis | therapeutic | 2450230 | |
| D003638 | D011802 | Deafness | marker/mechanism | 65671 4739610 | |
| D016757 | D011802 | Death, Sudden, Cardiac | marker/mechanism | 1388328 | |
| D003693 | D011802 | Delirium | marker/mechanism | 7340135 8134536 | |
| D003704 | D011802 | Dementia | marker/mechanism | 576891 | |
| D003967 | D011802 | Diarrhea | marker/mechanism | 4817707 | |
| D003875 | D011802 | Drug Eruptions | marker/mechanism | 590302 2923450 3156160 4716727 | |
| D004342 | D011802 | Drug Hypersensitivity | marker/mechanism | 1261756 3954525 7211571 7362358 | |
| D056486 | D011802 | Drug-Induced Liver Injury | marker/mechanism | 48362 331400 4642741 | |
| D064420 | D011802 | Drug-Related Side Effects and Adverse Reactions | marker/mechanism | 7283806 | |
| D005076 | D011802 | Exanthema | marker/mechanism | 3954525 | |
| D005334 | D011802 | Fever | marker/mechanism | 331400 3954525 7211571 7362358 | |
| D005767 | D011802 | Gastrointestinal Diseases | marker/mechanism | 3318368 | |
| D006099 | D011802 | Granuloma | marker/mechanism | 1261756 3954525 4433082 7362358 | |
| D034381 | D011802 | Hearing Loss | marker/mechanism | 8471402 | |
| D006323 | D011802 | Heart Arrest | marker/mechanism | 5031766 | |
| D006327 | D011802 | Heart Block | marker/mechanism | 75367 590302 | |
| D006333 | D011802 | Heart Failure | marker/mechanism therapeutic | 499305 590302 1544289 | |
| D006417 | D011802 | Hematuria | marker/mechanism | 5766081 | |
| D006505 | D011802 | Hepatitis | marker/mechanism | 1261756 3954525 4433082 7197395 7362358 | |
| D006529 | D011802 | Hepatomegaly | marker/mechanism | 7211571 | |
| D007008 | D011802 | Hypokalemia | marker/mechanism | 3571742 | |
| D007022 | D011802 | Hypotension | marker/mechanism | 590302 832287 1700225 4835257 6175805 | |
| D007024 | D011802 | Hypotension, Orthostatic | marker/mechanism | 3578348 3799644 | |
| D007674 | D011802 | Kidney Diseases | marker/mechanism | 8058588 | |
| D007970 | D011802 | Leukopenia | marker/mechanism | 331400 | |
| D054068 | D011802 | Livedo Reticularis | marker/mechanism | 2923450 3156160 4716727 | |
| D008133 | D011802 | Long QT Syndrome | marker/mechanism | 63370 463780 708526 1507842 2210166 2382671 2463611 3318368 3716981 3716982 4053138 4053141 6123639 6500767 6695683 7156952 7396607 7468313 7557819 7711344 9165569 11989578 12895193 15350150 15837031 16178046 17096683 17523411 20636881 | |
| D008180 | D011802 | Lupus Erythematosus, Systemic | marker/mechanism | 68769 | |
| D008181 | D011802 | Lupus Nephritis | marker/mechanism | 1082944 | |
| D008206 | D011802 | Lymphatic Diseases | marker/mechanism | 7197395 | |
| D008288 | D011802 | Malaria | therapeutic | 8957602 | |
| D016778 | D011802 | Malaria, Falciparum | therapeutic | 6340187 7711344 | |
| D019964 | D011802 | Mood Disorders | therapeutic | 16634036 | |
| D009103 | D011802 | Multiple Sclerosis | therapeutic | 16634036 19745644 | |
| D018908 | D011802 | Muscle Weakness | marker/mechanism | 3824038 | |
| D009325 | D011802 | Nausea | marker/mechanism | 75365 | |
| D009404 | D011802 | Nephrotic Syndrome | marker/mechanism | 4078916 | |
| D019954 | D011802 | Neurobehavioral Manifestations | therapeutic | 19745644 | |
| D010259 | D011802 | Paranoid Disorders | marker/mechanism | 2381359 | |
| D010291 | D011802 | Paresis | marker/mechanism | 9658874 | |
| D010787 | D011802 | Photosensitivity Disorders | marker/mechanism | 3156160 4716727 | |
| D011618 | D011802 | Psychotic Disorders | marker/mechanism | 2381359 | |
| D011693 | D011802 | Purpura | marker/mechanism | 3156160 4716727 | |
| D011695 | D011802 | Purpura, Schoenlein-Henoch | marker/mechanism | 4062457 7351760 | |
| D011696 | D011802 | Purpura, Thrombocytopenic | marker/mechanism | 7197395 | |
| D012131 | D011802 | Respiratory Insufficiency | marker/mechanism | 7297261 | |
| D012848 | D011802 | Sinoatrial Block | marker/mechanism | 5071356 | |
| D054138 | D011802 | Sinus Arrest, Cardiac | marker/mechanism | 7148661 | |
| D013163 | D011802 | Splenomegaly | marker/mechanism | 7211571 | |
| D013575 | D011802 | Syncope | marker/mechanism | 63370 463780 957762 2270707 3383622 3571742 4635436 6824397 7056119 7297261 9594237 9658874 | |
| D013610 | D011802 | Tachycardia | marker/mechanism therapeutic | 2093126 4835257 5922324 6149731 6175805 6286932 6486026 | |
| D013617 | D011802 | Tachycardia, Supraventricular | therapeutic | 3189164 | |
| D017180 | D011802 | Tachycardia, Ventricular | marker/mechanism therapeutic | 463780 646873 1562122 1703606 1704604 2433319 3189164 3716981 4635436 6633588 6695683 7233313 7445656 7468313 7557819 8154423 | |
| D013921 | D011802 | Thrombocytopenia | marker/mechanism | 760860 2815384 7362358 14744847 | |
| D016171 | D011802 | Torsades de Pointes | marker/mechanism | 63370 1423949 1507842 1562122 2210166 2382671 2416504 2423573 2463611 3378385 3383622 3654030 3716981 3716982 3919448 6123639 6137140 6695683 6695782 6824397 7056119 7156952 7235820 7264507 7276791 8055145 8187370 8230644 8628204 9141970 9165569 9165570 9309756 9658874 15837031 16178046 17523411 | |
| D014581 | D011802 | Urticaria | marker/mechanism | 7362358 | |
| D014605 | D011802 | Uveitis | marker/mechanism | 1399509 | |
| D014657 | D011802 | Vasculitis | marker/mechanism | 9923591 | |
| D018366 | D011802 | Vasculitis, Leukocytoclastic, Cutaneous | marker/mechanism | 4062457 | |
| D018754 | D011802 | Ventricular Dysfunction | marker/mechanism | 9309756 | |
| D014693 | D011802 | Ventricular Fibrillation | marker/mechanism therapeutic | 433766 970334 1388328 1507842 1562122 1704604 2416504 2478745 2726785 3393179 3704313 4079442 4635436 4966361 5659380 5941503 6633588 7233313 7468313 8187370 17523411 19215837 | |
| D054141 | D011802 | Ventricular Flutter | marker/mechanism | 970334 1562122 7445656 | |
| D018879 | D011802 | Ventricular Premature Complexes | marker/mechanism therapeutic | 3318368 6633588 6695683 7468313 | |
| D014786 | D011802 | Vision Disorders | marker/mechanism | 7198212 | |
| D014927 | D011802 | Wolff-Parkinson-White Syndrome | therapeutic | 4835257 |