id | C00031273 |
---|---|
Name | Salicylaldehyde |
CAS RN | 90-02-8 |
Standard InChI | InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H |
Standard InChI (Main Layer) | InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2076 |
By standard InChI | CHEMBL108925 |
---|---|
By standard InChI Main Layer | CHEMBL108925 |
By LinkDB | C06202 |
---|
By CAS RN | C013243 |
---|
class name | count |
---|---|
asterids | 1 |
family name | count |
---|---|
Asteraceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Anthemis aciphylla BOISS.var.discoidea BOISS | 99027 | Asteraceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL108925 |
CHEMBL1099470
(1)
|
0 / 0 |
P14679 | Tyrosinase | Oxidoreductase | CHEMBL108925 |
CHEMBL813550
(1)
|
4 / 2 |