| id | C00031273 |
|---|---|
| Name | Salicylaldehyde |
| CAS RN | 90-02-8 |
| Standard InChI | InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H |
| Standard InChI (Main Layer) | InChI=1S/C7H6O2/c8-5-6-3-1-2-4-7(6)9/h1-5,9H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2076 |
| By standard InChI | CHEMBL108925 |
|---|---|
| By standard InChI Main Layer | CHEMBL108925 |
| By LinkDB | C06202 |
|---|
| By CAS RN | C013243 |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Anthemis aciphylla BOISS.var.discoidea BOISS | 99027 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O00519 | Fatty-acid amide hydrolase 1 | Enzyme | CHEMBL108925 |
CHEMBL1099470
(1)
|
0 / 0 |
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL108925 |
CHEMBL813550
(1)
|
4 / 2 |