| id | C00031300 | 
|---|---|
| Name | Sargachromenol | 
| CAS RN | 70363-89-2 | 
| Standard InChI | InChI=1S/C27H36O4/c1-19(2)9-6-12-22(26(29)30)13-7-10-20(3)11-8-15-27(5)16-14-23-18-24(28)17-21(4)25(23)31-27/h9,11,13-14,16-18,28H,6-8,10,12,15H2,1-5H3,(H,29,30)/b20-11+,22-13+ | 
| Standard InChI (Main Layer) | InChI=1S/C27H36O4/c1-19(2)9-6-12-22(26(29)30)13-7-10-20(3)11-8-15-27(5)16-14-23-18-24(28)17-21(4)25(23)31-27/h9,11,13-14,16-18,28H,6-8,10,12,15H2,1-5H3,(H,29,30) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2359 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1668777 CHEMBL1668778 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Sargassaceae | 2 | 
| Asteraceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Roldana barba-johannis | 344068 | Asteraceae | asterids | Viridiplantae | 
| Sargassum fallax | 129343 | Sargassaceae | Eukaryota | |
| Sargassum thunbergii | 127542 | Sargassaceae | Eukaryota | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P10276 | Retinoic acid receptor alpha | NR1B1 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671298
                        (2) | 1 / 3 | 
| P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671295
                        (2) | 0 / 1 | 
| P06401 | Progesterone receptor | NR3C3 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671299
                        (2) | 0 / 1 | 
| Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671292
                        (2)
                        CHEMBL1671293
                        (2) | 0 / 0 | 
| P03372 | Estrogen receptor | NR3A1 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671300
                        (2) | 1 / 1 | 
| P08235 | Mineralocorticoid receptor | NR3C2 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671297
                        (2) | 2 / 2 | 
| P10275 | Androgen receptor | NR3C4 | CHEMBL1668777 CHEMBL1668778 | CHEMBL1671296
                        (2) | 3 / 4 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #612376 | Acute promyelocytic leukemia; apl | P10276 | 
| #300068 | Androgen insensitivity syndrome; ais | P10275 | 
| #312300 | Androgen insensitivity, partial; pais | P10275 | 
| #615363 | Estrogen resistance; estrr | P03372 | 
| #605115 | Hypertension, early-onset, autosomal dominant, with severe exacerbation in pregnancy | P08235 | 
| #177735 | Pseudohypoaldosteronism, type i, autosomal dominant; pha1a | P08235 | 
| #313200 | Spinal and bulbar muscular atrophy, x-linked 1; smax1 | P10275 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00026 | Endometrial Cancer | P03372
                            (marker) P06401 (marker) | 
| H00599 | 46,XX disorders of sex development (Disorders related to androgen excess) | P04150
                            (related) | 
| H00243 | Hyperkalemic distal renal tubular acidosis (RTA type 4) | P08235
                            (related) | 
| H00603 | Hypertension exacerbated in pregnancy | P08235
                            (related) | 
| H00024 | Prostate cancer | P10275
                            (related) | 
| H00062 | Spinal and bulbar muscular atrophy (SBMA) | P10275
                            (related) | 
| H00608 | 46,XY disorders of sex development (Disorders in androgen synthesis or action) | P10275
                            (related) | 
| H00609 | 46,XY disorders of sex development (Other) | P10275
                            (related) | 
| H00003 | Acute myeloid leukemia (AML) | P10276
                            (related) P10276 (marker) | 
| H00516 | Isolated orofacial clefts | P10276
                            (related) |