| id | C00003181 |
|---|---|
| Name | beta-Santalene |
| CAS RN | 511-59-1 |
| Standard InChI | InChI=1S/C15H24/c1-11(2)6-5-9-15(4)12(3)13-7-8-14(15)10-13/h6,13-14H,3,5,7-10H2,1-2,4H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H24/c1-11(2)6-5-9-15(4)12(3)13-7-8-14(15)10-13/h6,13-14H,3,5,7-10H2,1-2,4H3 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 1957 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB | C09718 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 2 |
| eudicotyledons | 2 |
| Embryophyta | 2 |
| family name | count |
|---|---|
| Santalaceae | 2 |
| Lepidolaenaceae | 1 |
| Asteraceae | 1 |
| Verbenaceae | 1 |
| Gymnomitriaceae | 1 |