id | C00032012 |
---|---|
Name | Methyl p-coumarate / Methyl p-hydroxycinnamate / Methyl 4-hydroxy cinnamate / 4-Hydroxycinnamic acid methyl ester |
CAS RN | 3943-97-3 |
Standard InChI | InChI=1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3/b7-4+ |
Standard InChI (Main Layer) | InChI=1S/C10H10O3/c1-13-10(12)7-4-8-2-5-9(11)6-3-8/h2-7,11H,1H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2416 |
By standard InChI | CHEMBL146816 |
---|---|
By standard InChI Main Layer | CHEMBL146816 |
By LinkDB |
---|
By CAS RN | C057918 |
---|
class name | count |
---|---|
rosids | 4 |
asterids | 3 |
Liliopsida | 3 |
family name | count |
---|---|
Rutaceae | 3 |
Poaceae | 1 |
Malvaceae | 1 |
Amaryllidaceae | 1 |
Orobanchaceae | 1 |
Lamiaceae | 1 |
Zingiberaceae | 1 |
Hydrangeaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P43166 | Carbonic anhydrase 7 | Lyase | CHEMBL146816 |
CHEMBL2340802
(1)
|
0 / 0 |
P00918 | Carbonic anhydrase 2 | Lyase | CHEMBL146816 |
CHEMBL2340803
(1)
|
1 / 2 |
Q9ULX7 | Carbonic anhydrase 14 | Lyase | CHEMBL146816 |
CHEMBL2340799
(1)
|
0 / 0 |
O43570 | Carbonic anhydrase 12 | Lyase | CHEMBL146816 |
CHEMBL2340800
(1)
|
1 / 2 |
P00915 | Carbonic anhydrase 1 | Lyase | CHEMBL146816 |
CHEMBL2340804
(1)
|
0 / 0 |
Q16790 | Carbonic anhydrase 9 | Lyase | CHEMBL146816 |
CHEMBL2340801
(1)
|
0 / 1 |