| id | C00032090 |
|---|---|
| Name | Citreorosein / omega-Hydroxyemodin |
| CAS RN | 481-73-2 |
| Standard InChI | InChI=1S/C15H10O6/c16-5-6-1-8-12(10(18)2-6)15(21)13-9(14(8)20)3-7(17)4-11(13)19/h1-4,16-19H,5H2 |
| Standard InChI (Main Layer) | InChI=1S/C15H10O6/c16-5-6-1-8-12(10(18)2-6)15(21)13-9(14(8)20)3-7(17)4-11(13)19/h1-4,16-19H,5H2 |
| Phytochemical cluster | No. 62 |
|---|---|
| KCF-S cluster | No. 41 |
| By standard InChI | CHEMBL290932 |
|---|---|
| By standard InChI Main Layer | CHEMBL290932 |
| By LinkDB | C17810 |
|---|
| By CAS RN | C053854 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Chaetomiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Zopfiella longicaudata | 330533 | Chaetomiaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08246 | Neutrophil elastase | S1A | CHEMBL290932 |
CHEMBL678119
(1)
|
2 / 1 |
| P08311 | Cathepsin G | S1A | CHEMBL290932 |
CHEMBL661854
(1)
|
0 / 0 |