id | C00032090 |
---|---|
Name | Citreorosein / omega-Hydroxyemodin |
CAS RN | 481-73-2 |
Standard InChI | InChI=1S/C15H10O6/c16-5-6-1-8-12(10(18)2-6)15(21)13-9(14(8)20)3-7(17)4-11(13)19/h1-4,16-19H,5H2 |
Standard InChI (Main Layer) | InChI=1S/C15H10O6/c16-5-6-1-8-12(10(18)2-6)15(21)13-9(14(8)20)3-7(17)4-11(13)19/h1-4,16-19H,5H2 |
Phytochemical cluster | No. 62 |
---|---|
KCF-S cluster | No. 41 |
By standard InChI | CHEMBL290932 |
---|---|
By standard InChI Main Layer | CHEMBL290932 |
By LinkDB | C17810 |
---|
By CAS RN | C053854 |
---|
class name | count |
---|
family name | count |
---|---|
Chaetomiaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Zopfiella longicaudata | 330533 | Chaetomiaceae | Fungi |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08246 | Neutrophil elastase | S1A | CHEMBL290932 |
CHEMBL678119
(1)
|
2 / 1 |
P08311 | Cathepsin G | S1A | CHEMBL290932 |
CHEMBL661854
(1)
|
0 / 0 |