| id | C00003245 |
|---|---|
| Name | Dehydrocostus lactone |
| CAS RN | 477-43-0 |
| Standard InChI | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2/t11-,12-,13-,14-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H18O2/c1-8-4-7-12-10(3)15(16)17-14(12)13-9(2)5-6-11(8)13/h11-14H,1-7H2 |
| Phytochemical cluster | No. 38 |
|---|---|
| KCF-S cluster | No. 306 |
| By standard InChI | CHEMBL88985 |
|---|---|
| By standard InChI Main Layer | CHEMBL88985 CHEMBL487201 CHEMBL1939730 |
| By LinkDB | C09387 |
|---|
| By CAS RN | C083030 |
|---|
| class name | count |
|---|---|
| asterids | 5 |
| Magnoliophyta | 1 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 5 |
| Lauraceae | 1 |
| Targioniaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P03372 | Estrogen receptor | NR3A1 | CHEMBL1939730 |
CHEMBL1941568
(1)
CHEMBL1941569
(1)
|
1 / 1 |