| id | C00000330 | 
|---|---|
| Name | Capillarin | 
| CAS RN | 3570-28-3 | 
| Standard InChI | InChI=1S/C13H10O2/c1-2-3-7-11-9-10-6-4-5-8-12(10)13(14)15-11/h4-6,8-9H,7H2,1H3 | 
| Standard InChI (Main Layer) | InChI=1S/C13H10O2/c1-2-3-7-11-9-10-6-4-5-8-12(10)13(14)15-11/h4-6,8-9H,7H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1865 | 
| By standard InChI | CHEMBL479330 | 
|---|---|
| By standard InChI Main Layer | CHEMBL479330 | 
| By LinkDB | C16926 | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 2 | 
| family name | count | 
|---|---|
| Asteraceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Artemisia capillaris | 265783 | Asteraceae | asterids | Viridiplantae | 
| Artemisia dracunculus | 72341 | Asteraceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL479330 | CHEMBL1794401
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL479330 | CHEMBL1738442
                        (1) | 0 / 0 |