| id | C00033556 |
|---|---|
| Name | 3,4-Dihydroxyphenethyl glucoside / (-)-3,4-Dihydroxyphenethyl glucoside |
| CAS RN | 76873-99-9 |
| Standard InChI | InChI=1S/C14H20O8/c15-6-10-11(18)12(19)13(20)14(22-10)21-4-3-7-1-2-8(16)9(17)5-7/h1-2,5,10-20H,3-4,6H2/t10-,11-,12+,13-,14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C14H20O8/c15-6-10-11(18)12(19)13(20)14(22-10)21-4-3-7-1-2-8(16)9(17)5-7/h1-2,5,10-20H,3-4,6H2 |
| Phytochemical cluster | No. 72 |
|---|---|
| KCF-S cluster | No. 45 |
| By standard InChI | CHEMBL1689261 |
|---|---|
| By standard InChI Main Layer | CHEMBL1689261 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Gesneriaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aeschynanthus bracteatus | 175969 | Gesneriaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL1689261 |
CHEMBL1693776
(1)
|
0 / 3 |