id | C00003363 |
---|---|
Name | Balchanin / Santamarin / Santamarine |
CAS RN | 4290-13-5 |
Standard InChI | InChI=1S/C15H20O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h4,10-13,16H,2,5-7H2,1,3H3/t10-,11+,12+,13-,15-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C15H20O3/c1-8-4-5-11(16)15(3)7-6-10-9(2)14(17)18-13(10)12(8)15/h4,10-13,16H,2,5-7H2,1,3H3 |
Phytochemical cluster | No. 38 |
---|---|
KCF-S cluster | No. 69 |
By standard InChI | CHEMBL89311 |
---|---|
By standard InChI Main Layer | CHEMBL89311 CHEMBL366059 |
By LinkDB | C09544 |
---|
By CAS RN | C016722 |
---|
class name | count |
---|---|
asterids | 11 |
Magnoliophyta | 1 |
family name | count |
---|---|
Asteraceae | 11 |
Magnoliaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q04206 | Transcription factor p65 | Transcription Factor | CHEMBL89311 CHEMBL366059 |
CHEMBL828644
(2)
CHEMBL861583
(2)
|
0 / 0 |
Q00653 | Nuclear factor NF-kappa-B p100 subunit | Transcription Factor | CHEMBL89311 CHEMBL366059 |
CHEMBL828644
(2)
|
0 / 0 |
P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL89311 CHEMBL366059 |
CHEMBL828644
(2)
|
0 / 0 |