id | C00033990 |
---|---|
Name | Kadsurin |
CAS RN | 51670-40-7 |
Standard InChI | InChI=1S/C25H30O8/c1-12-8-15-9-17(27-4)22(28-5)24(29-6)19(15)20-16(21(13(12)2)33-14(3)26)10-18-23(25(20)30-7)32-11-31-18/h9-10,12-13,21H,8,11H2,1-7H3 |
Standard InChI (Main Layer) | InChI=1S/C25H30O8/c1-12-8-15-9-17(27-4)22(28-5)24(29-6)19(15)20-16(21(13(12)2)33-14(3)26)10-18-23(25(20)30-7)32-11-31-18/h9-10,12-13,21H,8,11H2,1-7H3 |
Phytochemical cluster | No. 21 |
---|---|
KCF-S cluster | No. 105 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL559796 CHEMBL1460441 |
By LinkDB |
---|
By CAS RN | C075123 |
---|
class name | count |
---|---|
Magnoliophyta | 3 |
family name | count |
---|---|
Schisandraceae | 3 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Kadsura heteroclita | 124781 | Schisandraceae | Magnoliophyta | Viridiplantae |
Kadsura interior | 105749 | Schisandraceae | Magnoliophyta | Viridiplantae |
Schisandra propinqua var.sinensis | 13673 | Schisandraceae | Magnoliophyta | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1460441 |
CHEMBL1794584
(1)
|
2 / 0 |
O75496 | Geminin | Unclassified protein | CHEMBL1460441 |
CHEMBL2114780
(1)
|
0 / 0 |
P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1460441 |
CHEMBL2114788
(1)
|
0 / 0 |
Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL1460441 |
CHEMBL1794569
(1)
|
1 / 1 |