| id | C00033999 |
|---|---|
| Name | Koaburaside |
| CAS RN | 41653-73-0 |
| Standard InChI | InChI=1S/C14H20O9/c1-20-7-3-6(4-8(21-2)10(7)16)22-14-13(19)12(18)11(17)9(5-15)23-14/h3-4,9,11-19H,5H2,1-2H3/t9-,11-,12+,13-,14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C14H20O9/c1-20-7-3-6(4-8(21-2)10(7)16)22-14-13(19)12(18)11(17)9(5-15)23-14/h3-4,9,11-19H,5H2,1-2H3 |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 678 |
| By standard InChI | CHEMBL513117 |
|---|---|
| By standard InChI Main Layer | CHEMBL513117 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| family name | count |
|---|---|
| Capparaceae | 1 |
| Gesneriaceae | 1 |
| Rubiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aeschynanthus bracteatus | 175969 | Gesneriaceae | asterids | Viridiplantae |
| Canthium berberidifolium | 58501 | Rubiaceae | asterids | Viridiplantae |
| Capparis flavicans | 13394 | Capparaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL513117 |
CHEMBL980220
(1)
|
0 / 0 |
| P00734 | Prothrombin | S1A | CHEMBL513117 |
CHEMBL976587
(1)
|
4 / 2 |