| id | C00034798 | 
|---|---|
| Name | Arenarioside / Forsythoside F | 
| CAS RN | 94130-58-2 | 
| Standard InChI | InChI=1S/C34H44O19/c1-14-24(41)26(43)28(45)34(50-14)53-31-29(46)33(47-9-8-16-3-6-18(36)20(38)11-16)51-22(13-49-32-27(44)25(42)21(39)12-48-32)30(31)52-23(40)7-4-15-2-5-17(35)19(37)10-15/h2-7,10-11,14,21-22,24-39,41-46H,8-9,12-13H2,1H3/b7-4+/t14-,21+,22+,24-,25-,26+,27+,28+,29+,30+,31+,32-,33+,34-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C34H44O19/c1-14-24(41)26(43)28(45)34(50-14)53-31-29(46)33(47-9-8-16-3-6-18(36)20(38)11-16)51-22(13-49-32-27(44)25(42)21(39)12-48-32)30(31)52-23(40)7-4-15-2-5-17(35)19(37)10-15/h2-7,10-11,14,21-22,24-39,41-46H,8-9,12-13H2,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 33 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL506436 CHEMBL455827 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 3 | 
| family name | count | 
|---|---|
| Plantaginaceae | 2 | 
| Orobanchaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Globularia trichosantha | 285841 | Plantaginaceae | asterids | Viridiplantae | 
| Orobanche arenaria | 223091 | Orobanchaceae | asterids | Viridiplantae | 
| Veronica ligustrifolia A.Cunn | 4173 | Plantaginaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL455827 | CHEMBL1008495
                        (1) | 0 / 3 |