| id | C00035059 | 
|---|---|
| Name | Benzyl salicylate | 
| CAS RN | 118-58-1 | 
| Standard InChI | InChI=1S/C14H12O3/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9,15H,10H2 | 
| Standard InChI (Main Layer) | InChI=1S/C14H12O3/c15-13-9-5-4-8-12(13)14(16)17-10-11-6-2-1-3-7-11/h1-9,15H,10H2 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2308 | 
| By standard InChI | CHEMBL460124 | 
|---|---|
| By standard InChI Main Layer | CHEMBL460124 | 
| By LinkDB | 
|---|
| By CAS RN | C039672 | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Solanaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Nicotiana cavicola | 118690 | Solanaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q12809 | Potassium voltage-gated channel subfamily H member 2 | KCNH, Kv10-12.x (Ether-a-go-go) | CHEMBL460124 | CHEMBL1794573
                        (1) | 2 / 2 | 
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL460124 | CHEMBL1794399
                        (1) | 3 / 1 | 
| O75496 | Geminin | Unclassified protein | CHEMBL460124 | CHEMBL2114780
                        (1) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL460124 | CHEMBL1794401
                        (1) | 0 / 0 | 
| P51449 | Nuclear receptor ROR-gamma | Nuclear hormone receptor subfamily 1 group F member 3 | CHEMBL460124 | CHEMBL2114842
                        (1) | 0 / 0 | 
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL460124 | CHEMBL1738588
                        (1) | 0 / 0 | 
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL460124 | CHEMBL1737991
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL460124 | CHEMBL2114890
                        (1) | 0 / 0 | 
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL460124 | CHEMBL1614364
                        (2) | 1 / 1 | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C039672 | 2099 | ESR1 ER ESR ESRA ESTRR Era NR3A1 | estrogen receptor 1 | benzyl salicylate inhibits the reaction [Estradiol binds to ESR1 protein] | affects binding / decreases reaction | protein | 19338011 | 
| C039672 | 2099 | ESR1 ER ESR ESRA ESTRR Era NR3A1 | estrogen receptor 1 | benzyl salicylate results in increased activity of ESR1 protein | increases activity | protein | 22197706 | 
| C039672 | 2100 | ESR2 ER-BETA ESR-BETA ESRB ESTRB Erb NR3A2 | estrogen receptor 2 (ER beta) | benzyl salicylate inhibits the reaction [Estradiol binds to ESR2 protein] | affects binding / decreases reaction | protein | 19338011 | 
| C039672 | 7031 | TFF1 BCEI D21S21 HP1.A HPS2 pNR-2 pS2 | trefoil factor 1 | benzyl salicylate results in increased expression of TFF1 mRNA | increases expression | mRNA | 19338011 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #613688 | Long qt syndrome 2; lqt2 | Q12809 | 
| #609620 | Short qt syndrome 1; sqt1 | Q12809 | 
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 | Q9NUW8 | 
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth | P10828 | 
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth | P10828 | 
| #145650 | Thyroid hormone resistance, selective pituitary; prth | P10828 |