| id | C00035575 |
|---|---|
| Name | Desmethylxanthohumol |
| CAS RN | 115063-39-3 |
| Standard InChI | InChI=1S/C20H20O5/c1-12(2)3-9-15-17(23)11-18(24)19(20(15)25)16(22)10-6-13-4-7-14(21)8-5-13/h3-8,10-11,21,23-25H,9H2,1-2H3/b10-6+ |
| Standard InChI (Main Layer) | InChI=1S/C20H20O5/c1-12(2)3-9-15-17(23)11-18(24)19(20(15)25)16(22)10-6-13-4-7-14(21)8-5-13/h3-8,10-11,21,23-25H,9H2,1-2H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 133 |
| By standard InChI | CHEMBL466143 |
|---|---|
| By standard InChI Main Layer | CHEMBL466143 |
| By LinkDB | C16416 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Cannabaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Humulus lupulus | 3486 | Cannabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P31749 | RAC-alpha serine/threonine-protein kinase | Akt | CHEMBL466143 |
CHEMBL1918853
(1)
|
4 / 1 |