| id | C00036166 |
|---|---|
| Name | Mulberrofuran D |
| CAS RN | 83474-71-9 |
| Standard InChI | InChI=1S/C29H34O4/c1-18(2)7-6-8-20(5)10-13-24-26(31)14-11-21-15-28(33-29(21)24)25-16-22(30)17-27(32)23(25)12-9-19(3)4/h7,9-11,14-17,30-32H,6,8,12-13H2,1-5H3/b20-10+ |
| Standard InChI (Main Layer) | InChI=1S/C29H34O4/c1-18(2)7-6-8-20(5)10-13-24-26(31)14-11-21-15-28(33-29(21)24)25-16-22(30)17-27(32)23(25)12-9-19(3)4/h7,9-11,14-17,30-32H,6,8,12-13H2,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 319 |
| By standard InChI | CHEMBL517247 |
|---|---|
| By standard InChI Main Layer | CHEMBL517247 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Morus australis | 66392 | Moraceae | rosids | Viridiplantae |
| Morus mongolica | 229049 | Moraceae | rosids | Viridiplantae |
| Morus sp. | 3487 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL517247 |
CHEMBL1041807
(1)
CHEMBL1041808
(2)
|
0 / 0 |