| id | C00036226 | 
|---|---|
| Name | Tellimagrandin II | 
| CAS RN | 81571-72-4 | 
| Standard InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2 | 
| Standard InChI (Main Layer) | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)65-34-33-23(9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(40(61)64-33)8-22(49)30(54)32(25)56)63-41(67-38(59)12-5-19(46)28(52)20(47)6-12)35(34)66-37(58)11-3-17(44)27(51)18(45)4-11/h1-8,23,33-35,41-56H,9H2 | 
| Phytochemical cluster | No. 81 | 
|---|---|
| KCF-S cluster | No. 302 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL450745 CHEMBL510512 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| eudicotyledons | 1 | 
| rosids | 1 | 
| family name | count | 
|---|---|
| Saxifragaceae | 1 | 
| Rosaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Geum japonicum | 321607 | Rosaceae | rosids | Viridiplantae | 
| Tellima grandiflora | 29775 | Saxifragaceae | eudicotyledons | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P00742 | Coagulation factor X | S1A | CHEMBL510512 | CHEMBL1007649
                        (1)
                        CHEMBL1007650
                        (1) | 1 / 0 |