| id | C00036930 | 
|---|---|
| Name | Convolidine | 
| CAS RN | 63911-32-0 | 
| Standard InChI | InChI=1S/C15H19NO4/c1-19-14-6-9(2-5-13(14)17)15(18)20-12-7-10-3-4-11(8-12)16-10/h2,5-6,10-12,16-17H,3-4,7-8H2,1H3/t10-,11+,12+ | 
| Standard InChI (Main Layer) | InChI=1S/C15H19NO4/c1-19-14-6-9(2-5-13(14)17)15(18)20-12-7-10-3-4-11(8-12)16-10/h2,5-6,10-12,16-17H,3-4,7-8H2,1H3 | 
| Phytochemical cluster | No. 1 | 
|---|---|
| KCF-S cluster | No. 1355 | 
| By standard InChI | CHEMBL1384086 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1384086 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Convolvulaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Evolvulus sericeus | 113201 | Convolvulaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1384086 | CHEMBL1794483
                        (1) | 0 / 0 | 
| O00167 | Eyes absent homolog 2 | Enzyme | CHEMBL1384086 | CHEMBL1614315
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1384086 | CHEMBL1738442
                        (1) | 0 / 0 | 
| O00255 | Menin | Unclassified protein | CHEMBL1384086 | CHEMBL1614531
                        (1) | 2 / 5 | 
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1384086 | CHEMBL1614531
                        (1) | 1 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay | Q03164 | 
| #145000 | Hyperparathyroidism 1; hrpt1 | O00255 | 
| #131100 | Multiple endocrine neoplasia, type i; men1 | O00255 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00033 | Adrenal carcinoma | O00255
                            (related) | 
| H00034 | Carcinoid | O00255
                            (related) | 
| H00045 | Malignant islet cell carcinoma | O00255
                            (related) | 
| H00246 | Primary hyperparathyroidism | O00255
                            (related) | 
| H01102 | Pituitary adenomas | O00255
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q03164
                            (related) Q03164 (marker) | 
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) | Q03164
                            (related) |